(1,9-dihydroxy-2,10-dimethoxy-6a,7-dihydro-4H-dibenzo[de,g]quinolin-6(5H)-yl)(4-methoxyphenyl)methanone

ID: ALA4879312

PubChem CID: 164627546

Max Phase: Preclinical

Molecular Formula: C26H25NO6

Molecular Weight: 447.49

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(C(=O)N2CCc3cc(OC)c(O)c4c3C2Cc2cc(O)c(OC)cc2-4)cc1

Standard InChI:  InChI=1S/C26H25NO6/c1-31-17-6-4-14(5-7-17)26(30)27-9-8-15-12-22(33-3)25(29)24-18-13-21(32-2)20(28)11-16(18)10-19(27)23(15)24/h4-7,11-13,19,28-29H,8-10H2,1-3H3

Standard InChI Key:  UXCGRBAIFNJJSZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   16.9945  -16.3603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9934  -17.1798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6996  -15.9514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4082  -16.3567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8252  -17.1793    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.8263  -16.3587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1156  -15.9451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4071  -17.1773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7018  -17.5837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1093  -18.3960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1116  -17.5804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4040  -18.8024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7056  -18.3934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0043  -18.7938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0003  -19.6029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7034  -20.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4018  -19.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2865  -17.5899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2867  -15.9519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2865  -15.1347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7026  -20.8272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2913  -20.0093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5849  -19.5985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5302  -17.5925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5249  -18.4097    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2405  -17.1885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9419  -17.6048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6517  -17.2014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6574  -16.3834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9474  -15.9704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2405  -16.3761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3672  -15.9784    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.0728  -16.3906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  9  1  0
  4  3  2  0
  3  1  1  0
  4  8  1  0
  4  7  1  0
 11  5  1  0
  5  6  1  0
  6  7  1  0
  8  9  2  0
  8 11  1  0
  9 13  1  0
 12 10  1  0
 10 11  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  2 18  1  0
  1 19  1  0
 19 20  1  0
 16 21  1  0
 15 22  1  0
 22 23  1  0
  5 24  1  0
 24 25  2  0
 24 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 29 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4879312

    ---

Associated Targets(non-human)

EL4 (235 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 447.49Molecular Weight (Monoisotopic): 447.1682AlogP: 4.09#Rotatable Bonds: 4
Polar Surface Area: 88.46Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.30CX Basic pKa: CX LogP: 3.70CX LogD: 3.70
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.63Np Likeness Score: 0.69

References

1. Chang L, Zhang Q, Tang Y, Fang Y, Dou R, Chu Y, Xia Y, Wei Z, Chen L, Dai Y..  (2021)  Synthesis of norisoboldine derivatives and bioactivity assay for inducing the generation of regulatory T cells.,  37  [PMID:33556569] [10.1016/j.bmcl.2021.127844]

Source