5-(4-(Tert-butyl)phenyl)-1-(4-(pyridin-4-yl)benzyl)-1H-indole

ID: ALA4879317

PubChem CID: 164627550

Max Phase: Preclinical

Molecular Formula: C30H28N2

Molecular Weight: 416.57

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)(C)c1ccc(-c2ccc3c(ccn3Cc3ccc(-c4ccncc4)cc3)c2)cc1

Standard InChI:  InChI=1S/C30H28N2/c1-30(2,3)28-11-8-24(9-12-28)26-10-13-29-27(20-26)16-19-32(29)21-22-4-6-23(7-5-22)25-14-17-31-18-15-25/h4-20H,21H2,1-3H3

Standard InChI Key:  UHQXKCLILWMAPL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    1.2959  -14.0904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7087  -13.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8911  -13.3801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4171  -13.7932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4160  -14.6127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1240  -15.0217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8337  -14.6122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8309  -13.7896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1222  -13.3843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5385  -15.0190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5385  -15.8373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2460  -16.2447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2420  -14.6098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9501  -15.0135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9526  -15.8366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7362  -16.0886    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2180  -15.4212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7322  -14.7569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7091  -12.5675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9910  -16.8651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7908  -17.0326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0435  -17.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8426  -17.9747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3885  -17.3655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1298  -16.5858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3314  -16.4218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1885  -17.5320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4386  -18.3073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2378  -18.4740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7829  -17.8640    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5232  -17.0847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7246  -16.9217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
 10 11  2  0
 11 12  1  0
 12 15  2  0
 14 13  2  0
 13 10  1  0
  7 10  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 14  1  0
  4  2  1  0
  2 19  1  0
 16 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4879317

    ---

Associated Targets(non-human)

NS3 Genome polyprotein (385 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 416.57Molecular Weight (Monoisotopic): 416.2252AlogP: 7.72#Rotatable Bonds: 4
Polar Surface Area: 17.82Molecular Species: NEUTRALHBA: 2HBD:
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 5.11CX LogP: 7.64CX LogD: 7.64
Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.29Np Likeness Score: -0.94

References

1. Nie S, Zhao J, Wu X, Yao Y, Wu F, Lin YL, Li X, Kneubehl AR, Vogt MB, Rico-Hesse R, Song Y..  (2021)  Synthesis, structure-activity relationship and antiviral activity of indole-containing inhibitors of Flavivirus NS2B-NS3 protease.,  225  [PMID:34450494] [10.1016/j.ejmech.2021.113767]

Source