2,10-dimethoxy-6-(4-nitrobenzyl)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-1,9-diol

ID: ALA4879320

PubChem CID: 164627551

Max Phase: Preclinical

Molecular Formula: C25H24N2O6

Molecular Weight: 448.48

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc2c(cc1O)CC1c3c(cc(OC)c(O)c3-2)CCN1Cc1ccc([N+](=O)[O-])cc1

Standard InChI:  InChI=1S/C25H24N2O6/c1-32-21-12-18-16(10-20(21)28)9-19-23-15(11-22(33-2)25(29)24(18)23)7-8-26(19)13-14-3-5-17(6-4-14)27(30)31/h3-6,10-12,19,28-29H,7-9,13H2,1-2H3

Standard InChI Key:  YCSLAGAVFDYONU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   16.9120  -14.2059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9108  -15.0254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6171  -13.7970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3257  -14.2023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7426  -15.0249    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.7438  -14.2043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0330  -13.7907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3245  -15.0229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6193  -15.4293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0267  -16.2416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0291  -15.4260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3215  -16.6480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6231  -16.2390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9218  -16.6394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9177  -17.4485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6208  -17.8556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3192  -17.4529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2039  -15.4355    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2042  -13.7975    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2040  -12.9803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6201  -18.6728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2087  -17.8549    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5023  -17.4441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4477  -15.4381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1580  -15.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8593  -15.4504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5692  -15.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5749  -14.2290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8649  -13.8159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1579  -14.2216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2868  -13.8207    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.2910  -13.0035    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.9924  -14.2329    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  9  1  0
  4  3  2  0
  3  1  1  0
  4  8  1  0
  4  7  1  0
 11  5  1  0
  5  6  1  0
  6  7  1  0
  8  9  2  0
  8 11  1  0
  9 13  1  0
 12 10  1  0
 10 11  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  2 18  1  0
  1 19  1  0
 19 20  1  0
 16 21  1  0
 15 22  1  0
 22 23  1  0
  5 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 31 32  2  0
 31 33  1  0
 28 31  1  0
M  CHG  2  31   1  33  -1
M  END

Alternative Forms

  1. Parent:

    ALA4879320

    ---

Associated Targets(non-human)

EL4 (235 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.48Molecular Weight (Monoisotopic): 448.1634AlogP: 4.35#Rotatable Bonds: 5
Polar Surface Area: 105.30Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.51CX Basic pKa: 6.02CX LogP: 4.44CX LogD: 4.42
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.44Np Likeness Score: 0.50

References

1. Chang L, Zhang Q, Tang Y, Fang Y, Dou R, Chu Y, Xia Y, Wei Z, Chen L, Dai Y..  (2021)  Synthesis of norisoboldine derivatives and bioactivity assay for inducing the generation of regulatory T cells.,  37  [PMID:33556569] [10.1016/j.bmcl.2021.127844]

Source