2-Cyclopentyl-4-(2-phenylpyrimidin-4-yl)benzoic Acid

ID: ALA4879358

PubChem CID: 164628393

Max Phase: Preclinical

Molecular Formula: C22H20N2O2

Molecular Weight: 344.41

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)c1ccc(-c2ccnc(-c3ccccc3)n2)cc1C1CCCC1

Standard InChI:  InChI=1S/C22H20N2O2/c25-22(26)18-11-10-17(14-19(18)15-6-4-5-7-15)20-12-13-23-21(24-20)16-8-2-1-3-9-16/h1-3,8-15H,4-7H2,(H,25,26)

Standard InChI Key:  QLIOLMRSZBADBV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
   28.7453  -13.6189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4603  -13.2128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4630  -12.3924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7514  -11.9772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0356  -12.3884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0364  -13.2074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7566  -11.1549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4694  -10.7472    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.0449  -10.7414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.1699  -11.9834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9200  -12.3221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4737  -11.7162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0673  -11.0025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2632  -11.1699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7434  -14.4354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0283  -14.8416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0217  -15.6632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7334  -16.0784    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.4463  -14.8456    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.4516  -15.6633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1604  -16.0673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1618  -16.8856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8700  -17.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5773  -16.8806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5719  -16.0592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8631  -15.6568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  7  9  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 10  1  0
  3 10  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 20  1  0
 19 15  1  0
  1 15  1  0
 19 20  2  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 20 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4879358

    ---

Associated Targets(Human)

CAMKK2 Tchem CaM-kinase kinase beta (1281 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 344.41Molecular Weight (Monoisotopic): 344.1525AlogP: 5.17#Rotatable Bonds: 4
Polar Surface Area: 63.08Molecular Species: ACIDHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.93CX Basic pKa: 2.14CX LogP: 5.51CX LogD: 2.38
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.71Np Likeness Score: -0.62

References

1. Eduful BJ, O'Byrne SN, Temme L, Asquith CRM, Liang Y, Picado A, Pilotte JR, Hossain MA, Wells CI, Zuercher WJ, Catta-Preta CMC, Zonzini Ramos P, Santiago AS, Couñago RM, Langendorf CG, Nay K, Oakhill JS, Pulliam TL, Lin C, Awad D, Willson TM, Frigo DE, Scott JW, Drewry DH..  (2021)  Hinge Binder Scaffold Hopping Identifies Potent Calcium/Calmodulin-Dependent Protein Kinase Kinase 2 (CAMKK2) Inhibitor Chemotypes.,  64  (15.0): [PMID:34264658] [10.1021/acs.jmedchem.0c02274]

Source