The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-(5-chloro-4-(2-(ethylsulfinyl)phenylamino)pyrimidin-2-ylamino)-2-((2-(dimethylamino)ethyl)(methyl)amino)-4-methoxyphenyl)propionamide ID: ALA4879362
PubChem CID: 164628394
Max Phase: Preclinical
Molecular Formula: C27H36ClN7O3S
Molecular Weight: 574.15
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCC(=O)Nc1cc(Nc2ncc(Cl)c(Nc3ccccc3[S+]([O-])CC)n2)c(OC)cc1N(C)CCN(C)C
Standard InChI: InChI=1S/C27H36ClN7O3S/c1-7-25(36)30-20-15-21(23(38-6)16-22(20)35(5)14-13-34(3)4)32-27-29-17-18(28)26(33-27)31-19-11-9-10-12-24(19)39(37)8-2/h9-12,15-17H,7-8,13-14H2,1-6H3,(H,30,36)(H2,29,31,32,33)
Standard InChI Key: ZUBFRVSCYXCBQL-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 41 0 0 0 0 0 0 0 0999 V2000
20.5281 -5.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5270 -5.9191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2417 -6.3319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.9582 -5.9186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9554 -5.0880 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.2399 -4.6790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8135 -4.6794 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
21.2375 -3.8539 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.5218 -3.4436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5227 -2.6193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8078 -2.2089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0936 -2.6237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0987 -3.4529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8142 -3.8595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2369 -2.2062 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.9517 -2.6182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2363 -1.3813 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6733 -6.3300 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.8136 -7.5656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6746 -7.1551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9595 -7.5671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9604 -8.3913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6761 -8.8036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3923 -8.3855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3879 -7.5626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1002 -7.1466 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6658 -2.2052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6785 -9.6285 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.9652 -10.0431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3941 -10.0390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3966 -10.8640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1123 -11.2744 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.1147 -12.0994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8255 -10.8599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2464 -8.8046 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.5315 -8.3929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8174 -8.8061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1025 -8.3944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5306 -7.5679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
6 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
10 15 1 0
15 16 1 0
15 17 1 0
4 18 1 0
26 19 1 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
25 26 1 0
16 27 1 0
23 28 1 0
28 29 1 0
28 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
32 34 1 0
22 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
36 39 2 0
M CHG 2 15 1 17 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 574.15Molecular Weight (Monoisotopic): 573.2289AlogP: 5.10#Rotatable Bonds: 13Polar Surface Area: 117.71Molecular Species: BASEHBA: 9HBD: 3#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.05CX Basic pKa: 8.87CX LogP: 3.96CX LogD: 2.48Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.24Np Likeness Score: -1.29
References 1. Wu F, Yao H, Li W, Zhang N, Fan Y, Chan ASC, Li X, An B.. (2021) Synthesis and evaluation of novel 2,4-diaminopyrimidines bearing a sulfoxide moiety as anaplastic lymphoma kinase (ALK) inhibition agents., 48 [PMID:34245852 ] [10.1016/j.bmcl.2021.128253 ]