The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Benzyl-1-[(E)-2-(4-methoxy-phenyl)-vinyl]-9-(3-phenyl-propyl)-9H-beta-carbolin-2-ium bromide ID: ALA488441
PubChem CID: 25154820
Max Phase: Preclinical
Molecular Formula: C36H33BrN2O
Molecular Weight: 509.67
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=C/c2c3c(cc[n+]2Cc2ccccc2)c2ccccc2n3CCCc2ccccc2)cc1.[Br-]
Standard InChI: InChI=1S/C36H33N2O.BrH/c1-39-31-21-18-29(19-22-31)20-23-35-36-33(24-26-37(35)27-30-13-6-3-7-14-30)32-16-8-9-17-34(32)38(36)25-10-15-28-11-4-2-5-12-28;/h2-9,11-14,16-24,26H,10,15,25,27H2,1H3;1H/q+1;/p-1/b23-20+;
Standard InChI Key: NAKHVIPNTVDTIW-NMSJBYGBSA-M
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
3.1750 -8.8333 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
-2.8953 -5.3890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3787 -6.0604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0389 -6.8126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0763 -5.4688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7338 -6.2184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2182 -6.8936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7258 -7.5630 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9419 -6.4705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9402 -7.3007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2214 -7.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4960 -7.2952 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4902 -6.4618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2291 -6.0538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2187 -8.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4971 -8.9477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4998 -9.7727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2144 -10.1843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2120 -11.0085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5043 -11.4195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2198 -11.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2139 -10.1773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5081 -12.2445 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2044 -12.6602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2126 -7.7041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9249 -7.2879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6423 -7.7014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3499 -7.2920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3486 -6.4627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6286 -6.0518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9199 -6.4692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9752 -8.3494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7810 -8.5266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0304 -9.3130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8362 -9.4902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3914 -8.8821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1965 -9.0588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4450 -9.8459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8855 -10.4565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0825 -10.2767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 7 2 0
19 20 2 0
20 21 1 0
9 10 2 0
21 22 2 0
22 17 1 0
6 5 2 0
20 23 1 0
10 11 1 0
23 24 1 0
5 2 1 0
12 25 1 0
11 12 2 0
25 26 1 0
6 7 1 0
26 27 2 0
12 13 1 0
27 28 1 0
2 3 2 0
28 29 2 0
13 14 2 0
29 30 1 0
14 9 1 0
30 31 2 0
31 26 1 0
8 32 1 0
11 15 1 0
32 33 1 0
3 4 1 0
33 34 1 0
15 16 2 0
34 35 1 0
7 8 1 0
35 36 2 0
16 17 1 0
36 37 1 0
8 10 1 0
37 38 2 0
17 18 2 0
38 39 1 0
9 6 1 0
39 40 2 0
40 35 1 0
18 19 1 0
M CHG 2 1 -1 12 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 509.67Molecular Weight (Monoisotopic): 509.2587AlogP: 7.94#Rotatable Bonds: 9Polar Surface Area: 18.04Molecular Species: NEUTRALHBA: 2HBD: ┄#RO5 Violations: 2HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.29CX LogD: 4.29Aromatic Rings: 6Heavy Atoms: 39QED Weighted: 0.18Np Likeness Score: -0.16
References 1. Cao R, Yi W, Wu Q, Guan X, Feng M, Ma C, Chen Z, Song H, Peng W.. (2008) Synthesis and cytotoxic activities of 1-benzylidine substituted beta-carboline derivatives., 18 (24): [PMID:18952426 ] [10.1016/j.bmcl.2008.10.043 ] 2. Luo B, Song X.. (2021) A comprehensive overview of β-carbolines and its derivatives as anticancer agents., 224 [PMID:34332400 ] [10.1016/j.ejmech.2021.113688 ]