The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-[N-(2-Nitrobenzenesulfonyl)-N-(2-pivaloyloxyethyl)aminomethyl]-5-methyl-1H,3H-pyrimidin-2,4-dione ID: ALA489560
PubChem CID: 25141399
Max Phase: Preclinical
Molecular Formula: C19H24N4O8S
Molecular Weight: 468.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cn(CN(CCOC(=O)C(C)(C)C)S(=O)(=O)c2ccccc2[N+](=O)[O-])c(=O)[nH]c1=O
Standard InChI: InChI=1S/C19H24N4O8S/c1-13-11-21(18(26)20-16(13)24)12-22(9-10-31-17(25)19(2,3)4)32(29,30)15-8-6-5-7-14(15)23(27)28/h5-8,11H,9-10,12H2,1-4H3,(H,20,24,26)
Standard InChI Key: XBBGODXRKBTABG-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 33 0 0 0 0 0 0 0 0999 V2000
8.7758 0.5570 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4903 0.9695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2047 0.5570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2047 -0.2680 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4903 -0.6805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4903 -1.5055 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7758 -1.9180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7758 -2.7430 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4903 -3.1555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2047 -2.7430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2047 -1.9180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9192 -3.1555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4903 -3.9805 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0613 -1.5055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9192 -0.6805 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.3317 0.0340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5067 -1.3950 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6337 -1.0930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9192 0.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3317 1.4629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1567 1.4629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5692 0.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1567 0.0340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0613 0.9695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3468 0.5570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0613 1.7945 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6324 0.1445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9343 1.2715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7593 -0.1575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5692 -0.6805 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1567 -1.3950 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3942 -0.6805 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15 16 1 0
4 5 1 0
15 17 2 0
2 3 1 0
15 18 2 0
6 11 1 0
16 19 2 0
7 8 1 0
19 20 1 0
8 9 1 0
20 21 2 0
9 10 1 0
21 22 1 0
10 11 2 0
22 23 2 0
23 16 1 0
5 6 1 0
1 24 1 0
10 12 1 0
24 25 1 0
6 7 1 0
24 26 2 0
9 13 2 0
25 27 1 0
1 2 1 0
25 28 1 0
7 14 2 0
25 29 1 0
3 4 1 0
4 15 1 0
30 31 2 0
30 32 1 0
23 30 1 0
M CHG 2 30 1 32 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.49Molecular Weight (Monoisotopic): 468.1315AlogP: 0.99#Rotatable Bonds: 8Polar Surface Area: 161.68Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: ┄HBA (Lipinski): 12HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.99CX Basic pKa: ┄CX LogP: 2.22CX LogD: 2.22Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.34Np Likeness Score: -1.40
References 1. Gawin R, De Clercq E, Naesens L, Koszytkowska-Stawińska M.. (2008) Synthesis and antiviral evaluation of acyclic azanucleosides developed from sulfanilamide as a lead structure., 16 (18): [PMID:18778942 ] [10.1016/j.bmc.2008.08.041 ]