The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,3R,4S,5S,6S)-6-(methoxycarbonyl)tetrahydro-2H-pyran-2,3,4,5-tetrayl tetraacetate ID: ALA490224
Cas Number: 7355-18-2
PubChem CID: 95087
Product Number: M121081, Order Now?
Max Phase: Preclinical
Molecular Formula: C15H20O11
Molecular Weight: 376.31
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@H]1O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O
Standard InChI: InChI=1S/C15H20O11/c1-6(16)22-10-11(23-7(2)17)13(24-8(3)18)15(25-9(4)19)26-12(10)14(20)21-5/h10-13,15H,1-5H3/t10-,11-,12-,13+,15+/m0/s1
Standard InChI Key: DPOQCELSZBSZGX-XOBFJNJYSA-N
Molfile:
RDKit 2D
26 26 0 0 0 0 0 0 0 0999 V2000
-1.6843 -3.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9698 -3.6250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9698 -4.4500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6843 -4.8625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3987 -4.4500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3987 -3.6250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6843 -2.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9698 -1.9750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2553 -3.2125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2553 -4.8625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6843 -5.6875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1132 -4.8625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3987 -1.9750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2553 -2.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8277 -4.4500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5421 -4.8625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8277 -3.6250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3987 -6.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3987 -6.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1132 -5.6875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2553 -5.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4591 -6.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9698 -6.1000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4591 -3.6250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1736 -3.2125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4591 -4.4500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7 13 2 0
8 14 1 0
1 7 1 6
12 15 1 0
1 2 1 0
15 16 2 0
7 8 1 0
15 17 1 0
1 6 1 0
11 18 1 0
2 9 1 1
18 19 1 0
2 3 1 0
18 20 2 0
3 10 1 6
10 21 1 0
3 4 1 0
21 22 1 0
4 11 1 1
21 23 2 0
4 5 1 0
9 24 1 0
5 12 1 6
24 25 2 0
5 6 1 0
24 26 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 376.31Molecular Weight (Monoisotopic): 376.1006AlogP: -0.76#Rotatable Bonds: 5Polar Surface Area: 140.73Molecular Species: NEUTRALHBA: 11HBD: ┄#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: -0.70CX LogD: -0.70Aromatic Rings: ┄Heavy Atoms: 26QED Weighted: 0.44Np Likeness Score: 1.10
References 1. Randhawa P, Farasati NA, Huang Y.. (2007) BK Virus replication in vitro: limited effect of drugs interfering with viral uptake and intracellular transport., 51 (12): [PMID:17893158 ] [10.1128/aac.00843-07 ]