3-Oxo-Olean-12-en-29-oic acid methyl ester

ID: ALA490342

PubChem CID: 14707316

Max Phase: Preclinical

Molecular Formula: C31H48O3

Molecular Weight: 468.72

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)[C@]1(C)CC[C@]2(C)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1

Standard InChI:  InChI=1S/C31H48O3/c1-26(2)22-11-14-31(7)23(29(22,5)13-12-24(26)32)10-9-20-21-19-28(4,25(33)34-8)16-15-27(21,3)17-18-30(20,31)6/h9,21-23H,10-19H2,1-8H3/t21-,22-,23+,27+,28+,29-,30+,31+/m0/s1

Standard InChI Key:  PRTLPCCWLFLSPD-JCJNWAOQSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   -5.0683  -21.0721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0683  -21.9001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3538  -22.3099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3538  -20.6539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6392  -21.0721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6427  -21.9001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9313  -22.3149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2119  -21.9062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9243  -20.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2123  -21.0807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1953  -19.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9190  -19.8336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4834  -19.8503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4972  -20.6745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7943  -21.0963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0730  -20.6986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7665  -19.4480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0634  -19.8763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6552  -19.4839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6768  -18.6614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0262  -18.2330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7510  -18.6270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6481  -20.2901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4887  -19.0314    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4474  -17.5134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3806  -17.5134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2205  -20.2525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6465  -20.2441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7848  -22.3152    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7756  -23.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6507  -22.7239    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9314  -21.4861    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5054  -21.4986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0406  -16.7991    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9476  -23.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2085  -17.5058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6291  -18.2190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 17 18  1  0
  6  7  1  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  3  6  1  0
  5  4  1  0
 17 22  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
  5  6  1  0
 18 23  1  1
 17 24  1  1
  9 12  1  0
 21 25  1  1
 10 14  1  0
 21 26  1  0
 13 11  2  0
 10 27  1  1
 11 12  1  0
  5 28  1  1
 13 14  1  0
  2 29  2  0
  1  2  1  0
  3 30  1  0
  1  4  1  0
  6 31  1  6
  2  3  1  0
  9 32  1  6
  5  9  1  0
 14 33  1  6
 13 17  1  0
 26 34  2  0
 14 15  1  0
  3 35  1  0
 15 16  1  0
 26 36  1  0
 16 18  1  0
 36 37  1  0
M  END

Associated Targets(non-human)

Polb DNA polymerase beta (216 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 468.72Molecular Weight (Monoisotopic): 468.3603AlogP: 7.53#Rotatable Bonds: 1
Polar Surface Area: 43.37Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 7.30CX LogD: 7.30
Aromatic Rings: Heavy Atoms: 34QED Weighted: 0.29Np Likeness Score: 3.10

References

1. Sun DA, Starck SR, Locke EP, Hecht SM..  (1999)  DNA polymerase beta inhibitors from Sandoricum koetjape.,  62  (8): [PMID:10479314] [10.1021/np990104r]

Source