3-Oximo-olean-12-en-29-oic acid

ID: ALA490347

Max Phase: Preclinical

Molecular Formula: C30H47NO3

Molecular Weight: 469.71

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1(C)/C(=N\O)CC[C@]2(C)[C@H]3CC=C4[C@@H]5C[C@](C)(C(=O)O)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@@H]12

Standard InChI:  InChI=1S/C30H47NO3/c1-25(2)21-10-13-30(7)22(28(21,5)12-11-23(25)31-34)9-8-19-20-18-27(4,24(32)33)15-14-26(20,3)16-17-29(19,30)6/h8,20-22,34H,9-18H2,1-7H3,(H,32,33)/b31-23-/t20-,21-,22+,26+,27+,28-,29+,30+/m0/s1

Standard InChI Key:  RLZCOBFZPKISJW-MELGGVAUSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   12.4910  -20.8212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4910  -21.6491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2057  -22.0590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2057  -20.4030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9203  -20.8212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9168  -21.6491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6280  -22.0639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3474  -21.6553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6351  -20.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3471  -20.8298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3641  -19.1776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6405  -19.5827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0761  -19.5994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0621  -20.4236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7651  -20.8454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4864  -20.4477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7929  -19.1971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4959  -19.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2145  -19.2330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2363  -18.4105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5333  -17.9821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8084  -18.3761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2076  -20.0392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0707  -18.7805    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.1119  -17.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9399  -17.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3388  -20.0016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9129  -19.9932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7746  -22.0642    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7838  -22.7741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9086  -22.4730    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.6279  -21.2351    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.0539  -21.2477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5187  -16.5482    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6118  -22.7741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7679  -17.2548    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7758  -22.8922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 17 18  1  0
  6  7  1  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  3  6  1  0
  5  4  1  0
 17 22  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
  5  6  1  0
 18 23  1  1
 17 24  1  1
  9 12  1  0
 21 25  1  1
 10 14  1  0
 21 26  1  0
 13 11  2  0
 10 27  1  1
 11 12  1  0
  5 28  1  1
 13 14  1  0
  2 29  2  0
  1  2  1  0
  3 30  1  0
  1  4  1  0
  6 31  1  6
  2  3  1  0
  9 32  1  6
  5  9  1  0
 14 33  1  6
 13 17  1  0
 26 34  2  0
 14 15  1  0
  3 35  1  0
 15 16  1  0
 26 36  1  0
 16 18  1  0
 29 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA490347

    ---

Associated Targets(non-human)

Polb DNA polymerase beta (216 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 469.71Molecular Weight (Monoisotopic): 469.3556AlogP: 7.70#Rotatable Bonds: 1
Polar Surface Area: 69.89Molecular Species: ACIDHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.62CX Basic pKa: 2.45CX LogP: 7.17CX LogD: 4.45
Aromatic Rings: Heavy Atoms: 34QED Weighted: 0.23Np Likeness Score: 2.98

References

1. Sun DA, Starck SR, Locke EP, Hecht SM..  (1999)  DNA polymerase beta inhibitors from Sandoricum koetjape.,  62  (8): [PMID:10479314] [10.1021/np990104r]

Source