The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Oximo-olean-12-en-29-oic acid ID: ALA490347
Max Phase: Preclinical
Molecular Formula: C30H47NO3
Molecular Weight: 469.71
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)/C(=N\O)CC[C@]2(C)[C@H]3CC=C4[C@@H]5C[C@](C)(C(=O)O)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@@H]12
Standard InChI: InChI=1S/C30H47NO3/c1-25(2)21-10-13-30(7)22(28(21,5)12-11-23(25)31-34)9-8-19-20-18-27(4,24(32)33)15-14-26(20,3)16-17-29(19,30)6/h8,20-22,34H,9-18H2,1-7H3,(H,32,33)/b31-23-/t20-,21-,22+,26+,27+,28-,29+,30+/m0/s1
Standard InChI Key: RLZCOBFZPKISJW-MELGGVAUSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
12.4910 -20.8212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4910 -21.6491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2057 -22.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2057 -20.4030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9203 -20.8212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9168 -21.6491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6280 -22.0639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3474 -21.6553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6351 -20.4080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3471 -20.8298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3641 -19.1776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6405 -19.5827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0761 -19.5994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0621 -20.4236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7651 -20.8454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4864 -20.4477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7929 -19.1971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4959 -19.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2145 -19.2330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2363 -18.4105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5333 -17.9821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8084 -18.3761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2076 -20.0392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0707 -18.7805 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
17.1119 -17.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9399 -17.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3388 -20.0016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9129 -19.9932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7746 -22.0642 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7838 -22.7741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9086 -22.4730 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
14.6279 -21.2351 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
16.0539 -21.2477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5187 -16.5482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6118 -22.7741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7679 -17.2548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7758 -22.8922 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17 18 1 0
6 7 1 0
7 8 1 0
8 10 1 0
9 10 1 0
3 6 1 0
5 4 1 0
17 22 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
5 6 1 0
18 23 1 1
17 24 1 1
9 12 1 0
21 25 1 1
10 14 1 0
21 26 1 0
13 11 2 0
10 27 1 1
11 12 1 0
5 28 1 1
13 14 1 0
2 29 2 0
1 2 1 0
3 30 1 0
1 4 1 0
6 31 1 6
2 3 1 0
9 32 1 6
5 9 1 0
14 33 1 6
13 17 1 0
26 34 2 0
14 15 1 0
3 35 1 0
15 16 1 0
26 36 1 0
16 18 1 0
29 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 469.71Molecular Weight (Monoisotopic): 469.3556AlogP: 7.70#Rotatable Bonds: 1Polar Surface Area: 69.89Molecular Species: ACIDHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.62CX Basic pKa: 2.45CX LogP: 7.17CX LogD: 4.45Aromatic Rings: ┄Heavy Atoms: 34QED Weighted: 0.23Np Likeness Score: 2.98
References 1. Sun DA, Starck SR, Locke EP, Hecht SM.. (1999) DNA polymerase beta inhibitors from Sandoricum koetjape., 62 (8): [PMID:10479314 ] [10.1021/np990104r ]