4alpha-Phorbol 12,13-dihexanoate

ID: ALA490470

PubChem CID: 42638006

Product Number: P607179, Order Now?

Max Phase: Preclinical

Molecular Formula: C32H48O8

Molecular Weight: 560.73

Molecule Type: Small molecule

In stock!

Associated Items:

Names and Identifiers

Synonyms: 4Alpha-Phorbol 12,13-Dihexanoate | 4alpha-PDH|4alpha-Phorbol 12,13-dihexanoate|CHEMBL490470|GTPL4105|BDBM50277487|PD046439|Q27073752|(1S,2S,6S,10S,11R,13S,14R,15R)-14-(hexanoyloxy)-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxotetracyclo[8.5.0.0^{2,6}.0^{11,13}]pentadeca-3,8-dien-13-yl hexanoate

Canonical SMILES:  CCCCCC(=O)O[C@@H]1[C@@H](C)[C@@]2(O)[C@@H](C=C(CO)C[C@@]3(O)C(=O)C(C)=C[C@@H]23)[C@@H]2C(C)(C)[C@]12OC(=O)CCCCC

Standard InChI:  InChI=1S/C32H48O8/c1-7-9-11-13-24(34)39-28-20(4)31(38)22(16-21(18-33)17-30(37)23(31)15-19(3)27(30)36)26-29(5,6)32(26,28)40-25(35)14-12-10-8-2/h15-16,20,22-23,26,28,33,37-38H,7-14,17-18H2,1-6H3/t20-,22+,23-,26-,28-,30+,31-,32-/m1/s1

Standard InChI Key:  XGPRSRGBAHBMAF-QYSBVNMQSA-N

Molfile:  

     RDKit          2D

 43 46  0  0  0  0  0  0  0  0999 V2000
   -1.6005  -18.0371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9885  -18.5753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1649  -18.6373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4373  -16.8093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7238  -17.2227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7229  -15.5764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4399  -15.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4520  -17.8911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2028  -17.1008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8774  -16.6195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5437  -17.1124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2806  -17.8983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1269  -16.3487    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0418  -17.6811    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8662  -19.4064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0508  -19.5322    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8708  -18.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4917  -17.5125    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3305  -16.8644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7597  -18.5699    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7208  -14.7514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1543  -15.5744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0094  -15.9898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0161  -16.8097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3027  -16.4055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4333  -17.3917    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6042  -15.2708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4342  -14.3371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4321  -13.5121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2208  -15.2623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6259  -14.5436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6407  -15.9725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2792  -16.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5208  -16.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1497  -14.7477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8631  -14.3334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5786  -14.7441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2920  -14.3297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0091  -14.7404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4508  -14.5350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8559  -13.8163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6809  -13.8078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0859  -13.0891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 12 20  2  0
  2  3  1  0
  6 21  1  1
  4  5  1  0
  7 22  1  6
 24 23  1  0
 25 24  1  0
 23 25  1  0
  5  1  1  0
  9  4  1  0
  9 10  1  0
 10 11  2  0
 24 26  1  6
 11 12  1  0
 23 27  1  6
 12  8  1  0
 21 28  1  0
  8  2  1  0
 28 29  2  0
  4 13  1  6
 27 30  1  0
 30 31  1  0
  5 14  1  1
 30 32  2  0
  4  7  1  0
 25 33  1  0
  3 15  1  0
 25 34  1  0
  5 24  1  0
 28 35  1  0
 15 16  1  0
 35 36  1  0
 23  6  1  0
 36 37  1  0
  8 17  1  6
 37 38  1  0
  6  7  1  0
 38 39  1  0
  9 18  1  6
 31 40  1  0
  8  9  1  0
 40 41  1  0
 11 19  1  0
 41 42  1  0
  1  3  2  0
 42 43  1  0
M  END

Alternative Forms

  1. Parent:

    ALA490470

    4α-PDH

Associated Targets(Human)

HEK293 (82097 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Trpv4 Transient receptor potential cation channel subfamily V member 4 (46 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 560.73Molecular Weight (Monoisotopic): 560.3349AlogP: 4.19#Rotatable Bonds: 11
Polar Surface Area: 130.36Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.57CX Basic pKa: CX LogP: 4.17CX LogD: 4.17
Aromatic Rings: Heavy Atoms: 40QED Weighted: 0.19Np Likeness Score: 2.52

References

1. Klausen TK, Pagani A, Minassi A, Ech-Chahad A, Prenen J, Owsianik G, Hoffmann EK, Pedersen SF, Appendino G, Nilius B..  (2009)  Modulation of the transient receptor potential vanilloid channel TRPV4 by 4alpha-phorbol esters: a structure-activity study.,  52  (9): [PMID:19361196] [10.1021/jm9001007]

Source