The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
12beta-acetoxyergost-5-ene-3beta,23-diol ID: ALA490526
PubChem CID: 44566213
Max Phase: Preclinical
Molecular Formula: C30H50O4
Molecular Weight: 474.73
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)O[C@@H]1C[C@H]2[C@@H](CC=C3C[C@@H](O)CC[C@@]32C)[C@@H]2CC[C@H]([C@H](C)CC(O)[C@H](C)C(C)C)[C@@]12C
Standard InChI: InChI=1S/C30H50O4/c1-17(2)19(4)27(33)14-18(3)24-10-11-25-23-9-8-21-15-22(32)12-13-29(21,6)26(23)16-28(30(24,25)7)34-20(5)31/h8,17-19,22-28,32-33H,9-16H2,1-7H3/t18-,19-,22+,23+,24-,25+,26+,27?,28-,29+,30-/m1/s1
Standard InChI Key: FWOFLAFLCPNJMF-XMZRPQIDSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
-4.0058 -7.4448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0058 -8.2698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2936 -8.6801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2936 -7.0259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5773 -7.4448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5757 -8.2698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8651 -8.6816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1449 -8.2670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8641 -7.0274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1530 -7.4455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1453 -5.7943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4301 -6.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4356 -7.0337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3483 -7.2895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8331 -6.6252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3530 -5.9588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7249 -8.6838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5843 -6.6156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4415 -7.8573 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.1368 -4.9651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8526 -4.5453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8483 -3.7203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5727 -4.9546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1523 -6.6071 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.1486 -7.6161 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.2194 -5.4078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6112 -5.1717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0622 -4.5557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1767 -5.9578 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4233 -5.0012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8734 -6.1971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9738 -5.6157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7812 -5.4462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7168 -6.3997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3317 -6.0607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0381 -4.6623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0747 -6.8447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1391 -5.8912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6 7 2 0
7 8 1 0
8 10 1 0
9 10 1 0
9 31 1 0
10 13 1 0
12 11 1 0
11 31 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 12 1 0
2 17 1 1
5 18 1 1
10 19 1 1
11 20 1 1
20 21 1 0
21 22 2 0
21 23 1 0
9 24 1 6
13 25 1 6
12 26 1 1
16 27 1 0
27 30 1 0
27 28 1 6
16 29 1 6
1 2 1 0
30 32 1 0
1 4 1 0
32 33 1 0
2 3 1 0
32 34 1 0
3 6 1 0
33 35 1 0
5 4 1 0
33 36 1 6
5 6 1 0
35 37 1 0
5 9 1 0
35 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 474.73Molecular Weight (Monoisotopic): 474.3709AlogP: 6.15#Rotatable Bonds: 6Polar Surface Area: 66.76Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.30CX LogD: 5.30Aromatic Rings: ┄Heavy Atoms: 34QED Weighted: 0.36Np Likeness Score: 2.98
References 1. Wright AD, Goclik E, König GM.. (2003) Oxygenated analogues of gorgosterol and ergosterol from the soft coral Capnella lacertiliensis., 66 (2): [PMID:12608844 ] [10.1021/np0200111 ]