The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(6-(dimethylamino)-9-(4-methoxyphenyl)-3H-thioxanthen-3-ylidene)-N-methylmethanaminium hexafluorophosphate ID: ALA490909
PubChem CID: 44566092
Max Phase: Preclinical
Molecular Formula: C24H25F6N2OPS
Molecular Weight: 389.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2c3ccc(=[N+](C)C)cc-3sc3cc(N(C)C)ccc23)cc1.F[P-](F)(F)(F)(F)F
Standard InChI: InChI=1S/C24H25N2OS.F6P/c1-25(2)17-8-12-20-22(14-17)28-23-15-18(26(3)4)9-13-21(23)24(20)16-6-10-19(27-5)11-7-16;1-7(2,3,4,5)6/h6-15H,1-5H3;/q+1;-1
Standard InChI Key: PNWFBPOTQRAGSI-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
2.2642 -9.2869 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
1.5436 -9.6899 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.2527 -10.1112 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.9737 -9.7103 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.9855 -8.8883 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.2806 -8.4663 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.5595 -8.8670 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.0170 -12.0994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0181 -12.9253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3045 -13.3374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3063 -11.6873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5922 -12.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5888 -12.9273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8709 -13.3379 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.8777 -11.6748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1552 -12.0899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1523 -12.9253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5715 -13.3388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2930 -12.9179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2860 -12.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5616 -11.6696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8822 -10.8512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1670 -10.4400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8832 -9.2091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5960 -9.6265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1696 -9.6209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5951 -10.4490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0088 -13.3250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0140 -14.1486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7194 -12.9088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7316 -13.3365 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.4445 -12.9241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7323 -14.1601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8858 -8.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1739 -7.9715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
1 6 1 0
1 5 1 0
1 7 1 0
1 3 1 0
1 4 1 0
10 13 2 0
24 25 1 0
12 15 1 0
13 14 1 0
14 17 1 0
16 15 2 0
22 27 1 0
23 26 1 0
26 24 2 0
25 27 2 0
19 28 2 0
12 11 2 0
28 29 1 0
16 17 1 0
28 30 1 0
11 8 1 0
9 31 1 0
17 18 2 0
31 32 1 0
12 13 1 0
31 33 1 0
18 19 1 0
24 34 1 0
8 9 2 0
34 35 1 0
19 20 1 0
20 21 2 0
21 16 1 0
9 10 1 0
15 22 1 0
22 23 2 0
M CHG 2 1 -1 28 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 389.54Molecular Weight (Monoisotopic): 389.1682AlogP: 4.78#Rotatable Bonds: 3Polar Surface Area: 15.48Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.41CX LogP: 0.80CX LogD: 0.80Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.37Np Likeness Score: -0.60
References 1. Gannon MK, Holt JJ, Bennett SM, Wetzel BR, Loo TW, Bartlett MC, Clarke DM, Sawada GA, Higgins JW, Tombline G, Raub TJ, Detty MR.. (2009) Rhodamine inhibitors of P-glycoprotein: an amide/thioamide "switch" for ATPase activity., 52 (10): [PMID:19402665 ] [10.1021/jm900253g ]