N-(6-(dimethylamino)-9-(4-methoxyphenyl)-3H-thioxanthen-3-ylidene)-N-methylmethanaminium hexafluorophosphate

ID: ALA490909

PubChem CID: 44566092

Max Phase: Preclinical

Molecular Formula: C24H25F6N2OPS

Molecular Weight: 389.54

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2c3ccc(=[N+](C)C)cc-3sc3cc(N(C)C)ccc23)cc1.F[P-](F)(F)(F)(F)F

Standard InChI:  InChI=1S/C24H25N2OS.F6P/c1-25(2)17-8-12-20-22(14-17)28-23-15-18(26(3)4)9-13-21(23)24(20)16-6-10-19(27-5)11-7-16;1-7(2,3,4,5)6/h6-15H,1-5H3;/q+1;-1

Standard InChI Key:  PNWFBPOTQRAGSI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
    2.2642   -9.2869    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    1.5436   -9.6899    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.2527  -10.1112    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.9737   -9.7103    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.9855   -8.8883    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.2806   -8.4663    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.5595   -8.8670    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0170  -12.0994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0181  -12.9253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3045  -13.3374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3063  -11.6873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5922  -12.0958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5888  -12.9273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8709  -13.3379    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8777  -11.6748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1552  -12.0899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1523  -12.9253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5715  -13.3388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2930  -12.9179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2860  -12.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5616  -11.6696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8822  -10.8512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1670  -10.4400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8832   -9.2091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5960   -9.6265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1696   -9.6209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5951  -10.4490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0088  -13.3250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0140  -14.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7194  -12.9088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7316  -13.3365    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4445  -12.9241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7323  -14.1601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8858   -8.3856    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1739   -7.9715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  6  1  0
  1  5  1  0
  1  7  1  0
  1  3  1  0
  1  4  1  0
 10 13  2  0
 24 25  1  0
 12 15  1  0
 13 14  1  0
 14 17  1  0
 16 15  2  0
 22 27  1  0
 23 26  1  0
 26 24  2  0
 25 27  2  0
 19 28  2  0
 12 11  2  0
 28 29  1  0
 16 17  1  0
 28 30  1  0
 11  8  1  0
  9 31  1  0
 17 18  2  0
 31 32  1  0
 12 13  1  0
 31 33  1  0
 18 19  1  0
 24 34  1  0
  8  9  2  0
 34 35  1  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  9 10  1  0
 15 22  1  0
 22 23  2  0
M  CHG  2   1  -1  28   1
M  END

Associated Targets(non-human)

Abcb1a P-glycoprotein 3 (492 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 389.54Molecular Weight (Monoisotopic): 389.1682AlogP: 4.78#Rotatable Bonds: 3
Polar Surface Area: 15.48Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.41CX LogP: 0.80CX LogD: 0.80
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.37Np Likeness Score: -0.60

References

1. Gannon MK, Holt JJ, Bennett SM, Wetzel BR, Loo TW, Bartlett MC, Clarke DM, Sawada GA, Higgins JW, Tombline G, Raub TJ, Detty MR..  (2009)  Rhodamine inhibitors of P-glycoprotein: an amide/thioamide "switch" for ATPase activity.,  52  (10): [PMID:19402665] [10.1021/jm900253g]

Source