N-(6-(dimethylamino)-9-(5-(ethoxycarbonyl)thiophen-2-yl)-3H-thioxanthen-3-ylidene)-N-methylmethanaminium hexafluorophosphate

ID: ALA490910

PubChem CID: 44139342

Max Phase: Preclinical

Molecular Formula: C24H25F6N2O2PS2

Molecular Weight: 437.61

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1ccc(-c2c3ccc(=[N+](C)C)cc-3sc3cc(N(C)C)ccc23)s1.F[P-](F)(F)(F)(F)F

Standard InChI:  InChI=1S/C24H25N2O2S2.F6P/c1-6-28-24(27)20-12-11-19(29-20)23-17-9-7-15(25(2)3)13-21(17)30-22-14-16(26(4)5)8-10-18(22)23;1-7(2,3,4,5)6/h7-14H,6H2,1-5H3;/q+1;-1

Standard InChI Key:  CPJKUARDKCQOSD-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
   11.8930   -7.4288    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   11.1719   -7.8319    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.8815   -8.2537    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.6031   -7.8524    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.6148   -7.0298    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.9094   -6.6076    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.1879   -7.0085    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.9162   -9.9976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9150  -10.8242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6291  -11.2365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6273   -9.5853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3419   -9.9940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3453  -10.8262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0637  -11.2370    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.0569   -9.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7800   -9.9881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7829  -10.8242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5072  -11.2379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2291  -10.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2221   -9.9775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4972   -9.5675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0523   -8.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9455  -11.2241    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9508  -12.0482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6565  -10.8076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2010  -11.2356    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4876  -10.8230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2004  -12.0597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7107   -8.2597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4517   -7.4772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6276   -7.4818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3774   -8.2670    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.1394   -6.8177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4708   -6.0661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3206   -6.9115    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2900   -5.9768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7769   -6.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  6  1  0
  1  5  1  0
  1  7  1  0
  1  3  1  0
  1  4  1  0
 23 24  1  0
 13 14  1  0
 23 25  1  0
 14 17  1  0
  9 26  1  0
 16 15  2  0
 26 27  1  0
 26 28  1  0
 22 29  2  0
 12 11  2  0
 16 17  1  0
 11  8  1  0
 17 18  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 22  1  0
 12 13  1  0
 31 33  1  0
 18 19  1  0
  8  9  2  0
 33 34  1  0
 33 35  2  0
 19 20  1  0
 34 36  1  0
 36 37  1  0
 20 21  2  0
 21 16  1  0
  9 10  1  0
 15 22  1  0
 10 13  2  0
 19 23  2  0
 12 15  1  0
M  CHG  2   1  -1  23   1
M  END

Associated Targets(non-human)

Abcb1a P-glycoprotein 3 (492 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 437.61Molecular Weight (Monoisotopic): 437.1352AlogP: 5.01#Rotatable Bonds: 4
Polar Surface Area: 32.55Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 3.29CX LogP: 1.37CX LogD: 1.37
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.26Np Likeness Score: -0.71

References

1. Gannon MK, Holt JJ, Bennett SM, Wetzel BR, Loo TW, Bartlett MC, Clarke DM, Sawada GA, Higgins JW, Tombline G, Raub TJ, Detty MR..  (2009)  Rhodamine inhibitors of P-glycoprotein: an amide/thioamide "switch" for ATPase activity.,  52  (10): [PMID:19402665] [10.1021/jm900253g]

Source