The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-{4-[5-(2-Amino-4-oxo-3,4-dihydrothieno[2,3-d]pyrimidin-6-yl)-pentyl]benzoyl}-L-glutamic Acid ID: ALA491129
PubChem CID: 24771726
Max Phase: Preclinical
Molecular Formula: C23H26N4O6S
Molecular Weight: 486.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc2sc(CCCCCc3ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc3)cc2c(=O)[nH]1
Standard InChI: InChI=1S/C23H26N4O6S/c24-23-26-20(31)16-12-15(34-21(16)27-23)5-3-1-2-4-13-6-8-14(9-7-13)19(30)25-17(22(32)33)10-11-18(28)29/h6-9,12,17H,1-5,10-11H2,(H,25,30)(H,28,29)(H,32,33)(H3,24,26,27,31)/t17-/m0/s1
Standard InChI Key: OBGKKSLNXVLXEM-KRWDZBQOSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
3.3933 -15.4988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0924 -15.9359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8196 -15.5431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8429 -14.7159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1358 -14.2829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4154 -14.6759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5713 -14.3266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5924 -13.5007 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0018 -14.3727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7021 -14.8046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0230 -13.5469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3227 -13.1151 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4305 -14.4151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1307 -14.8469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8613 -14.4540 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3887 -14.2946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9981 -15.0186 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1279 -13.6172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7404 -14.3474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1798 -15.0496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6458 -15.6820 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.8816 -15.3739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9396 -14.5456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6938 -12.9134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1814 -15.8059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5473 -15.4139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2484 -15.8465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9726 -15.4559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6729 -15.8879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2733 -14.7599 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7535 -13.1540 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1073 -15.6717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9526 -13.5943 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2123 -14.2700 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 2 0
9 10 1 0
16 17 2 0
17 20 1 0
19 18 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 2 0
23 19 1 0
18 24 2 0
22 25 1 0
25 26 1 0
26 27 1 0
9 11 1 6
27 28 1 0
28 29 1 0
29 1 1 0
11 12 2 0
10 13 1 0
13 14 1 0
14 15 2 0
7 30 1 0
30 9 1 0
14 32 1 0
33 16 1 0
33 18 1 0
11 31 1 0
16 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 486.55Molecular Weight (Monoisotopic): 486.1573AlogP: 2.57#Rotatable Bonds: 12Polar Surface Area: 175.47Molecular Species: ACIDHBA: 7HBD: 5#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.34CX Basic pKa: 3.77CX LogP: 2.36CX LogD: -3.27Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.24Np Likeness Score: -0.48
References 1. Deng Y, Zhou X, Kugel Desmoulin S, Wu J, Cherian C, Hou Z, Matherly LH, Gangjee A.. (2009) Synthesis and biological activity of a novel series of 6-substituted thieno[2,3-d]pyrimidine antifolate inhibitors of purine biosynthesis with selectivity for high affinity folate receptors over the reduced folate carrier and proton-coupled folate transporter for cellular entry., 52 (9): [PMID:19371039 ] [10.1021/jm8011323 ]