The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Oxo-Olean-12-en-29-oic acid amide ID: ALA491485
PubChem CID: 10766120
Max Phase: Preclinical
Molecular Formula: C30H47NO2
Molecular Weight: 453.71
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)C(=O)CC[C@]2(C)[C@H]3CC=C4[C@@H]5C[C@](C)(C(N)=O)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@@H]12
Standard InChI: InChI=1S/C30H47NO2/c1-25(2)21-10-13-30(7)22(28(21,5)12-11-23(25)32)9-8-19-20-18-27(4,24(31)33)15-14-26(20,3)16-17-29(19,30)6/h8,20-22H,9-18H2,1-7H3,(H2,31,33)/t20-,21-,22+,26+,27+,28-,29+,30+/m0/s1
Standard InChI Key: MWFPSTQGLCPDBV-FUQFICMISA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
9.4718 -13.8878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4718 -14.7158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1864 -15.1255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1864 -13.4695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9010 -13.8878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8974 -14.7158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6088 -15.1305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3282 -14.7218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6158 -13.4745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3278 -13.8964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3448 -12.2442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6212 -12.6492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0568 -12.6660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0429 -13.4902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7458 -13.9120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4672 -13.5142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7736 -12.2636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4767 -12.6920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1953 -12.2995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2170 -11.4771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5139 -11.0487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7891 -11.4427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1883 -13.1057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0514 -11.8471 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
14.0927 -10.3291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9207 -10.3291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3196 -13.0681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8936 -13.0598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7553 -15.1308 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7645 -15.8406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8894 -15.5395 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.6087 -14.3018 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.0347 -14.3143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7460 -10.3192 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4995 -9.6148 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5925 -15.8406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16 18 1 0
17 18 1 0
6 7 1 0
7 8 1 0
8 10 1 0
9 10 1 0
3 6 1 0
5 4 1 0
17 22 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
5 6 1 0
18 23 1 1
17 24 1 1
9 12 1 0
21 25 1 1
10 14 1 0
21 26 1 0
13 11 2 0
10 27 1 1
11 12 1 0
5 28 1 1
13 14 1 0
2 29 2 0
1 2 1 0
3 30 1 0
1 4 1 0
6 31 1 6
2 3 1 0
9 32 1 6
5 9 1 0
14 33 1 6
13 17 1 0
14 15 1 0
26 34 1 0
26 35 2 0
15 16 1 0
3 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 453.71Molecular Weight (Monoisotopic): 453.3607AlogP: 6.84#Rotatable Bonds: 1Polar Surface Area: 60.16Molecular Species: NEUTRALHBA: 2HBD: 1#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.35CX LogD: 6.35Aromatic Rings: ┄Heavy Atoms: 33QED Weighted: 0.44Np Likeness Score: 3.01
References 1. Sun DA, Starck SR, Locke EP, Hecht SM.. (1999) DNA polymerase beta inhibitors from Sandoricum koetjape., 62 (8): [PMID:10479314 ] [10.1021/np990104r ]