3-Oxo-Olean-12-en-29-oic acid amide

ID: ALA491485

PubChem CID: 10766120

Max Phase: Preclinical

Molecular Formula: C30H47NO2

Molecular Weight: 453.71

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1(C)C(=O)CC[C@]2(C)[C@H]3CC=C4[C@@H]5C[C@](C)(C(N)=O)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@@H]12

Standard InChI:  InChI=1S/C30H47NO2/c1-25(2)21-10-13-30(7)22(28(21,5)12-11-23(25)32)9-8-19-20-18-27(4,24(31)33)15-14-26(20,3)16-17-29(19,30)6/h8,20-22H,9-18H2,1-7H3,(H2,31,33)/t20-,21-,22+,26+,27+,28-,29+,30+/m0/s1

Standard InChI Key:  MWFPSTQGLCPDBV-FUQFICMISA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
    9.4718  -13.8878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4718  -14.7158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1864  -15.1255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1864  -13.4695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9010  -13.8878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8974  -14.7158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6088  -15.1305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3282  -14.7218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6158  -13.4745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3278  -13.8964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3448  -12.2442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6212  -12.6492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0568  -12.6660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0429  -13.4902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7458  -13.9120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4672  -13.5142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7736  -12.2636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4767  -12.6920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1953  -12.2995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2170  -11.4771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5139  -11.0487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7891  -11.4427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1883  -13.1057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0514  -11.8471    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.0927  -10.3291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9207  -10.3291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3196  -13.0681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8936  -13.0598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7553  -15.1308    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7645  -15.8406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8894  -15.5395    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.6087  -14.3018    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.0347  -14.3143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7460  -10.3192    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.4995   -9.6148    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5925  -15.8406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 16 18  1  0
 17 18  1  0
  6  7  1  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  3  6  1  0
  5  4  1  0
 17 22  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
  5  6  1  0
 18 23  1  1
 17 24  1  1
  9 12  1  0
 21 25  1  1
 10 14  1  0
 21 26  1  0
 13 11  2  0
 10 27  1  1
 11 12  1  0
  5 28  1  1
 13 14  1  0
  2 29  2  0
  1  2  1  0
  3 30  1  0
  1  4  1  0
  6 31  1  6
  2  3  1  0
  9 32  1  6
  5  9  1  0
 14 33  1  6
 13 17  1  0
 14 15  1  0
 26 34  1  0
 26 35  2  0
 15 16  1  0
  3 36  1  0
M  END

Associated Targets(non-human)

Polb DNA polymerase beta (216 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 453.71Molecular Weight (Monoisotopic): 453.3607AlogP: 6.84#Rotatable Bonds: 1
Polar Surface Area: 60.16Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.35CX LogD: 6.35
Aromatic Rings: Heavy Atoms: 33QED Weighted: 0.44Np Likeness Score: 3.01

References

1. Sun DA, Starck SR, Locke EP, Hecht SM..  (1999)  DNA polymerase beta inhibitors from Sandoricum koetjape.,  62  (8): [PMID:10479314] [10.1021/np990104r]

Source