N-(9-(2-carboxyphenyl)-6-(dimethylamino)-3H-thioxanthen-3-ylidene)-N-methylmethanaminium hexafluorophosphate

ID: ALA491769

PubChem CID: 11512295

Max Phase: Preclinical

Molecular Formula: C24H23F6N2O2PS

Molecular Weight: 403.53

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C)c1ccc2c(-c3ccccc3C(=O)O)c3ccc(=[N+](C)C)cc-3sc2c1.F[P-](F)(F)(F)(F)F

Standard InChI:  InChI=1S/C24H22N2O2S.F6P/c1-25(2)15-9-11-19-21(13-15)29-22-14-16(26(3)4)10-12-20(22)23(19)17-7-5-6-8-18(17)24(27)28;1-7(2,3,4,5)6/h5-14H,1-4H3;/q;-1/p+1

Standard InChI Key:  CLXYWAAGPHGYAK-UHFFFAOYSA-O

Molfile:  

     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
    2.6611  -22.8796    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    1.9411  -23.2822    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.6496  -23.7032    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.3700  -23.3027    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.3818  -22.4814    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.6774  -22.0598    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.9571  -22.4601    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0626  -24.6341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0638  -25.4592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3508  -25.8710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3526  -24.2224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6392  -24.6304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6357  -25.4613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0815  -25.8715    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.0747  -24.2098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7966  -24.6246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7995  -25.4593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5226  -25.8723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2434  -25.4518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2365  -24.6140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5128  -24.2047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9586  -25.8587    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9639  -26.6815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6685  -25.4427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7767  -25.8701    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4889  -25.4581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7773  -26.6929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0702  -23.3871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7808  -22.9785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0653  -21.7479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6469  -22.1620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7783  -22.1592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6460  -22.9874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4711  -22.9802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8769  -22.2623    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8894  -23.6914    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  6  1  0
  1  5  1  0
  1  7  1  0
  1  3  1  0
  1  4  1  0
 12 15  1  0
 22 24  1  0
 13 14  1  0
  9 25  1  0
 14 17  1  0
 25 26  1  0
 16 15  2  0
 25 27  1  0
 15 28  1  0
 28 29  2  0
 12 11  2  0
 30 31  1  0
 16 17  1  0
 11  8  1  0
 17 18  2  0
 12 13  1  0
 28 33  1  0
 29 32  1  0
 32 30  2  0
 31 33  2  0
 18 19  1  0
 33 34  1  0
  8  9  2  0
 19 20  1  0
 34 35  1  0
 34 36  2  0
 20 21  2  0
 21 16  1  0
  9 10  1  0
 19 22  2  0
 10 13  2  0
 22 23  1  0
M  CHG  2   1  -1  22   1
M  END

Associated Targets(non-human)

Abcb1a P-glycoprotein 3 (492 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 403.53Molecular Weight (Monoisotopic): 403.1475AlogP: 4.47#Rotatable Bonds: 3
Polar Surface Area: 43.55Molecular Species: ACIDHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 3.82CX Basic pKa: 3.18CX LogP: 1.17CX LogD: 1.39
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.41Np Likeness Score: -0.57

References

1. Gannon MK, Holt JJ, Bennett SM, Wetzel BR, Loo TW, Bartlett MC, Clarke DM, Sawada GA, Higgins JW, Tombline G, Raub TJ, Detty MR..  (2009)  Rhodamine inhibitors of P-glycoprotein: an amide/thioamide "switch" for ATPase activity.,  52  (10): [PMID:19402665] [10.1021/jm900253g]

Source