3,6-Bis(N,N-dimethylamino)-9-(2-methylcarboxyphenyl)thioxanthyliumHexafluorophosphate

ID: ALA491770

PubChem CID: 11621054

Max Phase: Preclinical

Molecular Formula: C25H25F6N2O2PS

Molecular Weight: 417.55

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)c1ccccc1-c1c2ccc(=[N+](C)C)cc-2sc2cc(N(C)C)ccc12.F[P-](F)(F)(F)(F)F

Standard InChI:  InChI=1S/C25H25N2O2S.F6P/c1-26(2)16-10-12-20-22(14-16)30-23-15-17(27(3)4)11-13-21(23)24(20)18-8-6-7-9-19(18)25(28)29-5;1-7(2,3,4,5)6/h6-15H,1-5H3;/q+1;-1

Standard InChI Key:  IRYUKZSMQNHGEY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
   12.5950  -22.9792    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   11.8749  -23.3818    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.5835  -23.8030    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.3040  -23.4023    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.3158  -22.5808    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.6115  -22.1592    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.8910  -22.5596    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.8705  -24.7340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8694  -25.5593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5824  -25.9711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5806  -24.3222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2943  -24.7304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2977  -25.5613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0151  -25.9716    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.0082  -24.3096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7302  -24.7245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7331  -25.5593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4564  -25.9725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1774  -25.5518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1704  -24.7138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4465  -24.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8927  -25.9587    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8979  -26.7816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6027  -25.5427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1564  -25.9702    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4440  -25.5581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1557  -26.7931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0037  -23.4867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7144  -23.0781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9988  -21.8473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2866  -22.2614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7119  -22.2588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2875  -23.0870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4621  -23.0798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0563  -22.3618    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0438  -23.7911    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4742  -21.6529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  6  1  0
  1  5  1  0
  1  7  1  0
  1  3  1  0
  1  4  1  0
 22 24  1  0
 13 14  1  0
  9 25  1  0
 14 17  1  0
 25 26  1  0
 16 15  2  0
 25 27  1  0
 15 28  1  0
 28 29  2  0
 12 11  2  0
 30 31  1  0
 16 17  1  0
 11  8  1  0
 17 18  2  0
 12 13  1  0
 28 33  1  0
 29 32  1  0
 32 30  2  0
 31 33  2  0
 18 19  1  0
 33 34  1  0
  8  9  2  0
 19 20  1  0
 34 35  1  0
 34 36  2  0
 35 37  1  0
 20 21  2  0
 21 16  1  0
  9 10  1  0
 19 22  2  0
 10 13  2  0
 22 23  1  0
 12 15  1  0
M  CHG  2   1  -1  22   1
M  END

Associated Targets(non-human)

Abcb1a P-glycoprotein 3 (492 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 417.55Molecular Weight (Monoisotopic): 417.1631AlogP: 4.56#Rotatable Bonds: 3
Polar Surface Area: 32.55Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.37CX LogP: 0.96CX LogD: 0.96
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.28Np Likeness Score: -0.59

References

1. Gannon MK, Holt JJ, Bennett SM, Wetzel BR, Loo TW, Bartlett MC, Clarke DM, Sawada GA, Higgins JW, Tombline G, Raub TJ, Detty MR..  (2009)  Rhodamine inhibitors of P-glycoprotein: an amide/thioamide "switch" for ATPase activity.,  52  (10): [PMID:19402665] [10.1021/jm900253g]

Source