N-(9-(5-carboxythiophen-2-yl)-6-(dimethylamino)-3H-selenoxanthen-3-ylidene)-N-methylmethanaminium hexafluorophosphate

ID: ALA491928

PubChem CID: 16121977

Max Phase: Preclinical

Molecular Formula: C22H21F6N2O2PSSe

Molecular Weight: 456.45

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C)c1ccc2c(-c3ccc(C(=O)O)s3)c3ccc(=[N+](C)C)cc-3[se]c2c1.F[P-](F)(F)(F)(F)F

Standard InChI:  InChI=1S/C22H20N2O2SSe.F6P/c1-23(2)13-5-7-15-19(11-13)28-20-12-14(24(3)4)6-8-16(20)21(15)17-9-10-18(27-17)22(25)26;1-7(2,3,4,5)6/h5-12H,1-4H3;/q;-1/p+1

Standard InChI Key:  KSGLVFDCJFCWAS-UHFFFAOYSA-O

Molfile:  

     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
    1.9360   -2.3109    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    1.2147   -2.7141    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.9245   -3.1359    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.6462   -2.7347    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.6580   -1.9118    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.9524   -1.4894    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.2307   -1.8906    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0740   -5.0708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0752   -5.8969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3614   -6.3091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3632   -4.6588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6491   -5.0672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6456   -5.8990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9277   -6.3096    0.0000 Se  0  0  0  0  0  2  0  0  0  0  0  0
   -1.9344   -4.6461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2118   -5.0614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2089   -5.8969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4850   -6.3104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2365   -5.8894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2296   -5.0507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4949   -4.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9389   -3.8225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9524   -6.2967    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9577   -7.1203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6631   -5.8803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7888   -6.3081    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5017   -5.8958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7894   -7.1318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2746   -3.3349    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5335   -2.5529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3572   -2.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6073   -3.3422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0530   -1.8839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2391   -1.9637    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3979   -1.1316    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  6  1  0
  1  5  1  0
  1  7  1  0
  1  3  1  0
  1  4  1  0
 10 13  2  0
 20 21  2  0
 21 16  1  0
  8  9  2  0
 15 22  1  0
 12 15  1  0
 19 23  2  0
 13 14  1  0
 23 24  1  0
 14 17  1  0
 23 25  1  0
 16 15  2  0
  9 26  1  0
 12 11  2  0
 26 27  1  0
 11  8  1  0
 26 28  1  0
 22 29  1  0
 16 17  1  0
 12 13  1  0
 17 18  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 22  2  0
 18 19  1  0
 30 33  1  0
  9 10  1  0
 19 20  1  0
 33 34  1  0
 33 35  2  0
M  CHG  2   1  -1  23   1
M  END

Associated Targets(Human)

ABCB1 Tchem P-glycoprotein 1 (14716 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Abcb1a P-glycoprotein 3 (492 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 456.45Molecular Weight (Monoisotopic): 457.0483AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1. Gannon MK, Holt JJ, Bennett SM, Wetzel BR, Loo TW, Bartlett MC, Clarke DM, Sawada GA, Higgins JW, Tombline G, Raub TJ, Detty MR..  (2009)  Rhodamine inhibitors of P-glycoprotein: an amide/thioamide "switch" for ATPase activity.,  52  (10): [PMID:19402665] [10.1021/jm900253g]

Source