N-(9-(3,4-dimethoxyphenyl)-6-(dimethylamino)-3H-thioxanthen-3-ylidene)-N-methylmethanaminium hexafluorophosphate

ID: ALA491942

PubChem CID: 44566045

Max Phase: Preclinical

Molecular Formula: C25H27F6N2O2PS

Molecular Weight: 419.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2c3ccc(=[N+](C)C)cc-3sc3cc(N(C)C)ccc23)cc1OC.F[P-](F)(F)(F)(F)F

Standard InChI:  InChI=1S/C25H27N2O2S.F6P/c1-26(2)17-8-10-19-23(14-17)30-24-15-18(27(3)4)9-11-20(24)25(19)16-7-12-21(28-5)22(13-16)29-6;1-7(2,3,4,5)6/h7-15H,1-6H3;/q+1;-1

Standard InChI Key:  DEODTGUEIALCPH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
   11.9108  -12.6205    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   11.2284  -13.0012    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.9419  -13.4132    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.5245  -13.1718    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.6554  -12.1774    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.9419  -11.7655    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.3595  -12.0067    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.9713  -15.3561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9701  -16.1821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6838  -16.5942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6820  -14.9441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3960  -15.3526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3995  -16.1841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1173  -16.5947    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.1106  -14.9315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8331  -15.3467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8360  -16.1821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5598  -16.5956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2812  -16.1746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2743  -15.3360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5499  -14.9263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1061  -14.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8213  -13.6968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1051  -12.4659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3923  -12.8832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8187  -12.8776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3932  -13.7058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9971  -16.5818    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0023  -17.4053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7076  -16.1655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2566  -16.5933    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5438  -16.1809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2560  -17.4168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5312  -12.4648    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5299  -11.6412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1025  -11.6423    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8143  -11.2282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  6  1  0
  1  5  1  0
  1  7  1  0
  1  3  1  0
  1  4  1  0
 21 16  1  0
  8  9  2  0
 15 22  1  0
 22 23  2  0
 12 15  1  0
 24 25  1  0
 13 14  1  0
 14 17  1  0
 16 15  2  0
 12 11  2  0
 22 27  1  0
 23 26  1  0
 26 24  2  0
 25 27  2  0
 11  8  1  0
 19 28  2  0
 16 17  1  0
 28 29  1  0
 12 13  1  0
 28 30  1  0
 17 18  2  0
  9 31  1  0
 31 32  1  0
 18 19  1  0
 31 33  1  0
  9 10  1  0
 26 34  1  0
 19 20  1  0
 34 35  1  0
 10 13  2  0
 24 36  1  0
 20 21  2  0
 36 37  1  0
M  CHG  2   1  -1  28   1
M  END

Associated Targets(Human)

ABCB1 Tchem P-glycoprotein 1 (14716 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Abcb1a P-glycoprotein 3 (492 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.57Molecular Weight (Monoisotopic): 419.1788AlogP: 4.79#Rotatable Bonds: 4
Polar Surface Area: 24.71Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.40CX LogP: 0.65CX LogD: 0.65
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.35Np Likeness Score: -0.48

References

1. Gannon MK, Holt JJ, Bennett SM, Wetzel BR, Loo TW, Bartlett MC, Clarke DM, Sawada GA, Higgins JW, Tombline G, Raub TJ, Detty MR..  (2009)  Rhodamine inhibitors of P-glycoprotein: an amide/thioamide "switch" for ATPase activity.,  52  (10): [PMID:19402665] [10.1021/jm900253g]

Source