The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-Ac-Asp-D-Ala-Arg{N-omega-(N-methylcarbanoyl)}-OH ID: ALA492714
PubChem CID: 44572708
Max Phase: Preclinical
Molecular Formula: C17H29N7O8
Molecular Weight: 459.46
Molecule Type: Protein
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)NC(=N)NCCC[C@H](NC(=O)[C@@H](C)NC(=O)[C@H](CC(=O)O)NC(C)=O)C(=O)O
Standard InChI: InChI=1S/C17H29N7O8/c1-8(21-14(29)11(7-12(26)27)22-9(2)25)13(28)23-10(15(30)31)5-4-6-20-16(18)24-17(32)19-3/h8,10-11H,4-7H2,1-3H3,(H,21,29)(H,22,25)(H,23,28)(H,26,27)(H,30,31)(H4,18,19,20,24,32)/t8-,10+,11+/m1/s1
Standard InChI Key: ABYZFXCZXNIHDL-MIMYLULJSA-N
Molfile:
RDKit 2D
32 31 0 0 0 0 0 0 0 0999 V2000
16.9513 -19.3542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6658 -19.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3802 -19.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6658 -20.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9513 -21.0042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3802 -21.0042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0947 -19.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8092 -19.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5237 -19.7667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.2381 -19.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9526 -19.7667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.2381 -18.5292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.6671 -19.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3815 -19.7667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.6671 -18.5292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3815 -20.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9513 -18.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2368 -18.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6658 -18.1167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2368 -17.2917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5224 -18.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9513 -16.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9513 -16.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6658 -17.2917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6658 -15.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2368 -15.6417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2368 -14.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5224 -14.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9513 -14.4042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3802 -16.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3820 -16.8819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0965 -15.6444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 17 1 0
8 9 1 0
17 18 1 0
4 5 1 0
17 19 2 0
9 10 1 0
18 20 1 0
2 3 1 1
18 21 1 1
10 11 1 0
20 22 1 0
4 6 2 0
22 23 1 0
10 12 2 0
22 24 2 0
1 2 1 0
23 25 1 1
11 13 1 0
23 26 1 0
3 7 1 0
26 27 1 0
13 14 1 0
27 28 1 0
2 4 1 0
27 29 2 0
13 15 2 0
25 30 1 0
7 8 1 0
14 16 1 0
30 31 1 0
30 32 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 459.46Molecular Weight (Monoisotopic): 459.2078AlogP: -2.73#Rotatable Bonds: 12Polar Surface Area: 238.91Molecular Species: ZWITTERIONHBA: 7HBD: 9#RO5 Violations: 1HBA (Lipinski): 15HBD (Lipinski): 9#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.58CX Basic pKa: 9.67CX LogP: -5.58CX LogD: -8.43Aromatic Rings: ┄Heavy Atoms: 32QED Weighted: 0.08Np Likeness Score: 0.09
References 1. Sunazuka T, Sugawara A, Iguchi K, Hirose T, Nagai K, Noguchi Y, Saito Y, Yamamoto T, Ui H, Gouda H, Shiomi K, Watanabe T, Omura S.. (2009) Argifin; efficient solid phase total synthesis and evaluation of analogues of acyclic peptide., 17 (7): [PMID:19297173 ] [10.1016/j.bmc.2009.02.047 ]