N-(6-(dimethylamino)-9-(4-morpholinophenyl)-3H-selenoxanthen-3-ylidene)-N-methylmethanaminium hexafluorophosphate

ID: ALA493641

PubChem CID: 44566050

Max Phase: Preclinical

Molecular Formula: C27H30F6N3OPSe

Molecular Weight: 491.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C)c1ccc2c(-c3ccc(N4CCOCC4)cc3)c3ccc(=[N+](C)C)cc-3[se]c2c1.F[P-](F)(F)(F)(F)F

Standard InChI:  InChI=1S/C27H30N3OSe.F6P/c1-28(2)21-9-11-23-25(17-21)32-26-18-22(29(3)4)10-12-24(26)27(23)19-5-7-20(8-6-19)30-13-15-31-16-14-30;1-7(2,3,4,5)6/h5-12,17-18H,13-16H2,1-4H3;/q+1;-1

Standard InChI Key:  DZSAYWOFRWVADY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   10.1608  -20.6830    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    9.4784  -21.0637    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.1919  -21.4757    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.7745  -21.2343    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.9054  -20.2399    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.1919  -19.8280    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.6095  -20.0692    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.9146  -23.8813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9134  -24.7071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6269  -25.1193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6251  -23.4693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3392  -23.8776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3426  -24.7092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0605  -25.1198    0.0000 Se  0  0  0  0  0  2  0  0  0  0  0  0
    7.0537  -23.4566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7762  -23.8718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7791  -24.7072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5029  -25.1206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2242  -24.6997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2172  -23.8612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4929  -23.4515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0491  -22.6332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7643  -22.2220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0482  -20.9911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3354  -21.4086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7618  -21.4030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3363  -22.2310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9400  -25.1069    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9453  -25.9304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6505  -24.6906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1999  -25.1184    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4871  -24.7060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1993  -25.9419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0452  -20.1680    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7589  -19.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7583  -18.9353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0456  -18.5219    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3319  -18.9348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3309  -19.7609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  6  1  0
  1  5  1  0
  1  7  1  0
  1  3  1  0
  1  4  1  0
 15 22  1  0
 22 23  2  0
 12 15  1  0
 24 25  1  0
 13 14  1  0
 14 17  1  0
 16 15  2  0
 12 11  2  0
 22 27  1  0
 23 26  1  0
 26 24  2  0
 25 27  2  0
 11  8  1  0
 19 28  2  0
 16 17  1  0
 28 29  1  0
 12 13  1  0
 28 30  1  0
 17 18  2  0
  9 31  1  0
 31 32  1  0
 18 19  1  0
 31 33  1  0
 34 35  1  0
  9 10  1  0
 19 20  1  0
 10 13  2  0
 20 21  2  0
 21 16  1  0
  8  9  2  0
 34 39  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 24 34  1  0
M  CHG  2   1  -1  28   1
M  END

Associated Targets(Human)

ABCB1 Tchem P-glycoprotein 1 (14716 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Abcb1a P-glycoprotein 3 (492 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 491.52Molecular Weight (Monoisotopic): 492.1549AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1. Gannon MK, Holt JJ, Bennett SM, Wetzel BR, Loo TW, Bartlett MC, Clarke DM, Sawada GA, Higgins JW, Tombline G, Raub TJ, Detty MR..  (2009)  Rhodamine inhibitors of P-glycoprotein: an amide/thioamide "switch" for ATPase activity.,  52  (10): [PMID:19402665] [10.1021/jm900253g]

Source