The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-Cyclopropyl-4-methyl-3-(1-((S)-2,2,2-trifluoro-1-methylethoxy)-6-phthalazinyl)benzamide ID: ALA493671
PubChem CID: 24854903
Max Phase: Preclinical
Molecular Formula: C22H20F3N3O2
Molecular Weight: 415.42
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(C(=O)NC2CC2)cc1-c1ccc2c(O[C@@H](C)C(F)(F)F)nncc2c1
Standard InChI: InChI=1S/C22H20F3N3O2/c1-12-3-4-15(20(29)27-17-6-7-17)10-19(12)14-5-8-18-16(9-14)11-26-28-21(18)30-13(2)22(23,24)25/h3-5,8-11,13,17H,6-7H2,1-2H3,(H,27,29)/t13-/m0/s1
Standard InChI Key: XANMCBRIKIVXBI-ZDUSSCGKSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
-3.5581 -18.4698 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5593 -19.2974 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8464 -19.7103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8484 -18.0571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1303 -18.4658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1292 -19.2932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4133 -19.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6980 -19.2889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7031 -18.4584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4195 -18.0512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0064 -18.0412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7238 -18.4508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4350 -18.0344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4301 -17.2086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7080 -16.8010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0002 -17.2196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7185 -16.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1519 -18.4426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1568 -19.2676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8639 -18.0260 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5808 -18.4342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9976 -19.1445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4058 -18.4276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8457 -20.5353 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1308 -20.9471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1301 -21.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4168 -20.5340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1358 -22.5947 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.3052 -21.7745 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.9551 -21.7719 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14 15 1 0
1 2 2 0
15 16 2 0
16 11 1 0
9 11 1 0
7 8 2 0
16 17 1 0
5 4 2 0
13 18 1 0
8 9 1 0
18 19 2 0
4 1 1 0
18 20 1 0
9 10 2 0
20 21 1 0
22 21 1 0
23 22 1 0
21 23 1 0
10 5 1 0
2 3 1 0
3 24 1 0
11 12 2 0
24 25 1 0
5 6 1 0
25 26 1 1
12 13 1 0
25 27 1 0
3 6 2 0
26 28 1 0
13 14 2 0
26 29 1 0
6 7 1 0
26 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 415.42Molecular Weight (Monoisotopic): 415.1508AlogP: 4.83#Rotatable Bonds: 5Polar Surface Area: 64.11Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.81CX LogP: 4.27CX LogD: 4.27Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.65Np Likeness Score: -1.00
References 1. Herberich B, Cao GQ, Chakrabarti PP, Falsey JR, Pettus L, Rzasa RM, Reed AB, Reichelt A, Sham K, Thaman M, Wurz RP, Xu S, Zhang D, Hsieh F, Lee MR, Syed R, Li V, Grosfeld D, Plant MH, Henkle B, Sherman L, Middleton S, Wong LM, Tasker AS.. (2008) Discovery of highly selective and potent p38 inhibitors based on a phthalazine scaffold., 51 (20): [PMID:18817365 ] [10.1021/jm8005417 ]