The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl 4-(2,6-dichlorophenyl)-2-methyl-5-oxo-7-phenyl-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate ID: ALA495044
PubChem CID: 24851505
Max Phase: Preclinical
Molecular Formula: C24H21Cl2NO3
Molecular Weight: 442.34
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)C1=C(C)NC2=C(C(=O)CC(c3ccccc3)C2)C1c1c(Cl)cccc1Cl
Standard InChI: InChI=1S/C24H21Cl2NO3/c1-13-20(24(29)30-2)23(21-16(25)9-6-10-17(21)26)22-18(27-13)11-15(12-19(22)28)14-7-4-3-5-8-14/h3-10,15,23,27H,11-12H2,1-2H3
Standard InChI Key: LXMOZAGRDNRNQF-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
5.5075 -9.4664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5075 -10.2914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2220 -10.7039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2220 -9.0539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9364 -9.4664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9364 -10.2914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6509 -10.7039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3654 -10.2914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3654 -9.4664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6509 -9.0539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2220 -8.2289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0798 -9.0539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7943 -9.4664 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0798 -8.2289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0798 -10.7039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6509 -8.2289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9364 -7.8164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9364 -6.9914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6509 -6.5789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3654 -6.9914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3654 -7.8164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1858 -7.7301 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.7930 -10.7039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7930 -11.5289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0785 -11.9414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3641 -11.5289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3641 -10.7039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0785 -10.2914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1159 -7.7301 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.5088 -9.0539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
8 15 1 0
3 6 1 0
10 16 1 0
5 4 1 0
16 17 2 0
5 10 1 0
17 18 1 0
6 7 1 0
18 19 2 0
7 8 1 0
19 20 1 0
8 9 2 0
20 21 2 0
21 16 1 0
9 10 1 0
21 22 1 0
5 6 2 0
2 23 1 0
4 11 2 0
23 24 2 0
24 25 1 0
1 2 1 0
25 26 2 0
1 4 1 0
26 27 1 0
12 13 1 0
27 28 2 0
28 23 1 0
12 14 2 0
17 29 1 0
9 12 1 0
13 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.34Molecular Weight (Monoisotopic): 441.0898AlogP: 5.53#Rotatable Bonds: 3Polar Surface Area: 55.40Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.77CX LogD: 4.77Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.64Np Likeness Score: -0.71
References 1. Gündüz MG, Sevim Oztürk G, Vural IM, Simşek R, Sarioğlu Y, Safak C.. (2008) Evaluation of myorelaxant activity of 7-substituted hexahydroquinoline derivatives in isolated rabbit gastric fundus., 43 (3): [PMID:17590241 ] [10.1016/j.ejmech.2007.04.012 ]