The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8alpha,15(S)-dihydroxy-23,6alpha-epoxy-labd-13(14),17-dien-16(S),19-olide ID: ALA496239
PubChem CID: 44157540
Max Phase: Preclinical
Molecular Formula: C25H38O5
Molecular Weight: 418.57
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1=CC(=O)O[C@@H]1[C@@H](O)/C=C(\C)CC[C@@H]1[C@@]2(C)CCC[C@@]3(C)CO[C@@H](C[C@@]1(C)O)[C@@H]32
Standard InChI: InChI=1S/C25H38O5/c1-15(11-17(26)21-16(2)12-20(27)30-21)7-8-19-24(4)10-6-9-23(3)14-29-18(22(23)24)13-25(19,5)28/h11-12,17-19,21-22,26,28H,6-10,13-14H2,1-5H3/b15-11+/t17-,18-,19+,21-,22-,23-,24+,25+/m0/s1
Standard InChI Key: GAOMOYCMAISIED-URISLNGFSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
3.2375 -2.7333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2375 -3.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9495 -3.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9495 -2.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6615 -2.7333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6580 -3.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3668 -3.9716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0836 -3.5644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3622 -4.7965 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5292 -4.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3542 -4.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6555 -4.5583 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.3738 -2.3216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0895 -2.7403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8033 0.1670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0885 -0.2521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0973 -1.0849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3746 -1.4947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2415 -1.8245 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.3707 0.1546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3640 0.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5556 2.2032 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7472 2.3633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3405 1.6478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8976 1.0437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4056 3.1207 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6542 -1.9083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7350 0.2349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8000 -3.1500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4958 -2.0208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0751 1.3978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6462 1.3862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4811 1.9367 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.2297 -4.4770 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5 13 1 0
6 7 1 0
7 8 1 0
13 18 1 0
15 16 1 0
16 17 1 0
17 18 1 0
8 14 1 0
13 19 1 6
3 6 1 0
16 20 2 0
7 9 1 0
21 20 1 0
5 4 1 0
32 21 1 0
32 22 1 0
3 10 1 1
5 6 1 0
3 11 1 0
9 11 1 0
22 23 1 0
23 24 1 0
24 25 2 0
32 25 1 0
23 26 2 0
6 12 1 6
5 27 1 1
13 14 1 0
25 28 1 0
1 2 1 0
14 29 1 6
1 4 1 0
14 30 1 0
2 3 1 0
21 31 1 1
32 33 1 1
7 34 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 418.57Molecular Weight (Monoisotopic): 418.2719AlogP: 3.93#Rotatable Bonds: 5Polar Surface Area: 75.99Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.43CX Basic pKa: ┄CX LogP: 3.42CX LogD: 3.42Aromatic Rings: ┄Heavy Atoms: 30QED Weighted: 0.52Np Likeness Score: 2.82
References 1. Dal Piaz F, Vassallo A, Lepore L, Tosco A, Bader A, De Tommasi N.. (2009) Sesterterpenes as tubulin tyrosine ligase inhibitors. First insight of structure-activity relationships and discovery of new lead., 52 (12): [PMID:19459643 ] [10.1021/jm801637f ]