(+/-)-1,2-bis[5-(E)-hept-5-ene-1,3-diynylthiophen-2-yl]-2-hydroxypentane-1,4-dione

ID: ALA496243

PubChem CID: 16083190

Max Phase: Preclinical

Molecular Formula: C27H20O3S2

Molecular Weight: 456.59

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: xanthopappin C | XANTHOPAPPIN C|CHEMBL496243|1,2-bis[5-( e )-hept-5-ene-1,3-diynylthiophen-2-yl]-2-hydroxypentane-1,4-dione|1,2-bis[5-[(E)-hept-5-en-1,3-diynyl]thiophen-2-yl]-2-hydroxypentane-1,4-dione

Canonical SMILES:  C/C=C/C#CC#Cc1ccc(C(=O)C(O)(CC(C)=O)c2ccc(C#CC#C/C=C/C)s2)s1

Standard InChI:  InChI=1S/C27H20O3S2/c1-4-6-8-10-12-14-22-16-18-24(31-22)26(29)27(30,20-21(3)28)25-19-17-23(32-25)15-13-11-9-7-5-2/h4-7,16-19,30H,20H2,1-3H3/b6-4+,7-5+

Standard InChI Key:  YIPZRWXKZQNUSS-YDFGWWAZSA-N

Molfile:  

     RDKit          2D

 32 33  0  0  0  0  0  0  0  0999 V2000
   18.2357    1.7064    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.5658    1.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8148    0.4383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6423    0.4336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8984    1.2169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7411    1.2221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9161    1.2221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0911    1.2221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2661    1.2221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4411    1.2221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0297    0.5076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2047    0.5076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2887    2.5616    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.9587    3.0430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7097    3.8296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8821    3.8344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6261    3.0510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7833    3.0458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6083    3.0458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4333    3.0458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2583    3.0458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0833    3.0458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4958    3.7603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3208    3.7603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9083    2.6458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1917    2.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5013    3.3635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.3159    1.9285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1408    1.9228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4796    2.6541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7627    2.2457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4843    3.4791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 15 16  1  0
 16 17  2  0
 17 13  1  0
  3  4  1  0
 14 18  1  0
  8  9  3  0
 18 19  3  0
  4  5  2  0
 19 20  1  0
  9 10  1  0
 20 21  3  0
  5  1  1  0
 21 22  1  0
 10 11  2  0
 22 23  2  0
  1  2  1  0
 23 24  1  0
 11 12  1  0
 17 25  1  0
 13 14  1  0
 25 26  1  0
  2  6  1  0
 25 27  1  0
 25 28  1  0
 28  5  1  0
  6  7  3  0
 28 29  2  0
  2  3  2  0
 26 30  1  0
  7  8  1  0
 30 31  1  0
 14 15  2  0
 30 32  2  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(non-human)

Aedes albopictus (15 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 456.59Molecular Weight (Monoisotopic): 456.0854AlogP: 4.72#Rotatable Bonds: 5
Polar Surface Area: 54.37Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.57CX Basic pKa: CX LogP: 6.84CX LogD: 6.84
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.52Np Likeness Score: 1.35

References

1. Tian Y, Wei X, Xu H..  (2006)  Photoactivated insecticidal thiophene derivatives from Xanthopappus subacaulis.,  69  (8): [PMID:16933888] [10.1021/np060209b]

Source