The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(+/-)-1,2-bis[5-(E)-hept-5-ene-1,3-diynylthiophen-2-yl]-2-hydroxypentane-1,4-dione ID: ALA496243
PubChem CID: 16083190
Max Phase: Preclinical
Molecular Formula: C27H20O3S2
Molecular Weight: 456.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: xanthopappin C | XANTHOPAPPIN C|CHEMBL496243|1,2-bis[5-( e )-hept-5-ene-1,3-diynylthiophen-2-yl]-2-hydroxypentane-1,4-dione|1,2-bis[5-[(E)-hept-5-en-1,3-diynyl]thiophen-2-yl]-2-hydroxypentane-1,4-dione
Canonical SMILES: C/C=C/C#CC#Cc1ccc(C(=O)C(O)(CC(C)=O)c2ccc(C#CC#C/C=C/C)s2)s1
Standard InChI: InChI=1S/C27H20O3S2/c1-4-6-8-10-12-14-22-16-18-24(31-22)26(29)27(30,20-21(3)28)25-19-17-23(32-25)15-13-11-9-7-5-2/h4-7,16-19,30H,20H2,1-3H3/b6-4+,7-5+
Standard InChI Key: YIPZRWXKZQNUSS-YDFGWWAZSA-N
Molfile:
RDKit 2D
32 33 0 0 0 0 0 0 0 0999 V2000
18.2357 1.7064 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.5658 1.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8148 0.4383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6423 0.4336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8984 1.2169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7411 1.2221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9161 1.2221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0911 1.2221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2661 1.2221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4411 1.2221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0297 0.5076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2047 0.5076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2887 2.5616 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.9587 3.0430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7097 3.8296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8821 3.8344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6261 3.0510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7833 3.0458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6083 3.0458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4333 3.0458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2583 3.0458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0833 3.0458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4958 3.7603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3208 3.7603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9083 2.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1917 2.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5013 3.3635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.3159 1.9285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1408 1.9228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4796 2.6541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7627 2.2457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4843 3.4791 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15 16 1 0
16 17 2 0
17 13 1 0
3 4 1 0
14 18 1 0
8 9 3 0
18 19 3 0
4 5 2 0
19 20 1 0
9 10 1 0
20 21 3 0
5 1 1 0
21 22 1 0
10 11 2 0
22 23 2 0
1 2 1 0
23 24 1 0
11 12 1 0
17 25 1 0
13 14 1 0
25 26 1 0
2 6 1 0
25 27 1 0
25 28 1 0
28 5 1 0
6 7 3 0
28 29 2 0
2 3 2 0
26 30 1 0
7 8 1 0
30 31 1 0
14 15 2 0
30 32 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.59Molecular Weight (Monoisotopic): 456.0854AlogP: 4.72#Rotatable Bonds: 5Polar Surface Area: 54.37Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.57CX Basic pKa: ┄CX LogP: 6.84CX LogD: 6.84Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.52Np Likeness Score: 1.35
References 1. Tian Y, Wei X, Xu H.. (2006) Photoactivated insecticidal thiophene derivatives from Xanthopappus subacaulis., 69 (8): [PMID:16933888 ] [10.1021/np060209b ]