(+/-)-5-(1,2-diacetoxyethyl)-2-(E)-hept-5-ene-1,3-diynylthiophene

ID: ALA496641

PubChem CID: 44583856

Max Phase: Preclinical

Molecular Formula: C17H16O4S

Molecular Weight: 316.38

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C/C=C/C#CC#Cc1ccc(C(COC(C)=O)OC(C)=O)s1

Standard InChI:  InChI=1S/C17H16O4S/c1-4-5-6-7-8-9-15-10-11-17(22-15)16(21-14(3)19)12-20-13(2)18/h4-5,10-11,16H,12H2,1-3H3/b5-4+

Standard InChI Key:  SZRQIJOTIIDHCG-SNAWJCMRSA-N

Molfile:  

     RDKit          2D

 22 22  0  0  0  0  0  0  0  0999 V2000
    4.3054   -6.8384    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.9754   -6.3570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7264   -5.5704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8988   -5.5656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6428   -6.3490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8000   -6.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6250   -6.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4500   -6.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2750   -6.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1000   -6.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5125   -5.6397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3375   -5.6397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9250   -6.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2146   -6.3348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4961   -6.7403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9170   -7.5791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1986   -7.9847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1906   -8.8097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4881   -7.5653    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7857   -6.3209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0672   -6.7265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7937   -5.4960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 10 11  2  0
  1  2  1  0
 11 12  1  0
  2  6  1  0
  5 13  1  0
 13 14  1  0
  6  7  3  0
 14 15  1  0
  2  3  2  0
 13 16  1  0
  7  8  1  0
 16 17  1  0
  3  4  1  0
 17 18  1  0
  8  9  3  0
 17 19  2  0
  4  5  2  0
 15 20  1  0
  9 10  1  0
 20 21  1  0
  5  1  1  0
 20 22  2  0
M  END

Associated Targets(non-human)

Aedes albopictus (15 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 316.38Molecular Weight (Monoisotopic): 316.0769AlogP: 2.85#Rotatable Bonds: 4
Polar Surface Area: 52.60Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.49CX LogD: 3.49
Aromatic Rings: 1Heavy Atoms: 22QED Weighted: 0.63Np Likeness Score: 2.08

References

1. Tian Y, Wei X, Xu H..  (2006)  Photoactivated insecticidal thiophene derivatives from Xanthopappus subacaulis.,  69  (8): [PMID:16933888] [10.1021/np060209b]

Source