(R)-2-(9-(1H-Benzo[d]imidazol-1-yl)nonyl)-2,5,7,8-tetramethylchroman-6-ol

ID: ALA497110

PubChem CID: 25119389

Max Phase: Preclinical

Molecular Formula: C29H40N2O2

Molecular Weight: 448.65

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(C)c2c(c(C)c1O)CC[C@@](C)(CCCCCCCCCn1cnc3ccccc31)O2

Standard InChI:  InChI=1S/C29H40N2O2/c1-21-22(2)28-24(23(3)27(21)32)16-18-29(4,33-28)17-12-8-6-5-7-9-13-19-31-20-30-25-14-10-11-15-26(25)31/h10-11,14-15,20,32H,5-9,12-13,16-19H2,1-4H3/t29-/m1/s1

Standard InChI Key:  NVGXSEOYGGSDBW-GDLZYMKVSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   -2.2047   -0.2125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4927    0.1958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4927    1.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2047    1.4376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9169    0.1958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9143    1.0191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6248    1.4311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3384    1.0211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3370    0.1947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6258   -0.2136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0506   -0.2193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6248   -1.0387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6231    2.2561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0528    1.4337    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0876   -0.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7834    0.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0658    0.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6456    0.6233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3632    0.2162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0746    0.6340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7922    0.2269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5036    0.6448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2212    0.2377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9326    0.6556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6502    0.2484    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9548   -0.0151    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3980    0.5937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5475   -0.7327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7425   -0.5639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1956   -1.1761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4528   -1.9572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2618   -2.1227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8050   -1.5093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2 16  1  0
  7  8  2  0
 16 17  1  0
  2  3  1  0
 17 18  1  0
  8  9  1  0
 18 19  1  0
  3  4  1  0
 19 20  1  0
  9 10  2  0
 20 21  1  0
 10  5  1  0
 21 22  1  0
 22 23  1  0
  9 11  1  0
 23 24  1  0
  6  4  1  0
 24 25  1  0
 25 29  1  0
 10 12  1  0
  5  6  2  0
 28 26  1  0
 26 27  2  0
 27 25  1  0
  7 13  1  0
  5  1  1  0
 28 29  2  0
  8 14  1  0
 29 30  1  0
  6  7  1  0
 30 31  2  0
  2 15  1  6
 31 32  1  0
  1  2  1  0
 32 33  2  0
 33 28  1  0
M  END

Associated Targets(Human)

CYP4F2 Tchem Cytochrome P450 4F2 (83 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.65Molecular Weight (Monoisotopic): 448.3090AlogP: 7.57#Rotatable Bonds: 10
Polar Surface Area: 47.28Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.80CX Basic pKa: 5.37CX LogP: 8.43CX LogD: 8.43
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.33Np Likeness Score: 0.43

References

1. Ohnmacht S, Nava P, West R, Parker R, Atkinson J..  (2008)  Inhibition of oxidative metabolism of tocopherols with omega-N-heterocyclic derivatives of vitamin E.,  16  (16): [PMID:18656365] [10.1016/j.bmc.2008.07.020]

Source