The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-2-(9-(1H-benzo[d][1,2,3]Triazol-1-yl)nonyl)-2,5,7,8-tetramethylchroman-6-ol ID: ALA497279
PubChem CID: 25119393
Max Phase: Preclinical
Molecular Formula: C28H39N3O2
Molecular Weight: 449.64
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(C)c2c(c(C)c1O)CC[C@@](C)(CCCCCCCCCn1nnc3ccccc31)O2
Standard InChI: InChI=1S/C28H39N3O2/c1-20-21(2)27-23(22(3)26(20)32)16-18-28(4,33-27)17-12-8-6-5-7-9-13-19-31-25-15-11-10-14-24(25)29-30-31/h10-11,14-15,32H,5-9,12-13,16-19H2,1-4H3/t28-/m1/s1
Standard InChI Key: VEXAQKBTMMMJFK-MUUNZHRXSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-2.2047 -0.2125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4927 0.1958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4927 1.0209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2047 1.4376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9169 0.1958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9143 1.0191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6248 1.4311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3384 1.0211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3370 0.1947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6258 -0.2136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0506 -0.2193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6248 -1.0387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6231 2.2561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0528 1.4337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0876 -0.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7834 0.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0658 0.2054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6456 0.6233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3632 0.2162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0746 0.6340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7922 0.2269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5036 0.6448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2212 0.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9326 0.6556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6502 0.2484 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9548 -0.0151 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3980 0.5937 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5475 -0.7327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7425 -0.5639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1956 -1.1761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4528 -1.9572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2618 -2.1227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8050 -1.5093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 16 1 0
7 8 2 0
16 17 1 0
2 3 1 0
17 18 1 0
8 9 1 0
18 19 1 0
3 4 1 0
19 20 1 0
9 10 2 0
20 21 1 0
10 5 1 0
21 22 1 0
22 23 1 0
9 11 1 0
23 24 1 0
6 4 1 0
24 25 1 0
25 29 1 0
10 12 1 0
5 6 2 0
28 26 1 0
26 27 2 0
27 25 1 0
7 13 1 0
5 1 1 0
28 29 2 0
8 14 1 0
29 30 1 0
6 7 1 0
30 31 2 0
2 15 1 6
31 32 1 0
1 2 1 0
32 33 2 0
33 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 449.64Molecular Weight (Monoisotopic): 449.3042AlogP: 6.97#Rotatable Bonds: 10Polar Surface Area: 60.17Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.80CX Basic pKa: 0.44CX LogP: 8.38CX LogD: 8.38Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.34Np Likeness Score: 0.18
References 1. Ohnmacht S, Nava P, West R, Parker R, Atkinson J.. (2008) Inhibition of oxidative metabolism of tocopherols with omega-N-heterocyclic derivatives of vitamin E., 16 (16): [PMID:18656365 ] [10.1016/j.bmc.2008.07.020 ]