The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3,4-dihydroxyphenyl)-1-heptyl-7-isopropyl-1H-imidazo[4,5-g]quinoxalin-6(5H)-one ID: ALA497880
PubChem CID: 135950293
Max Phase: Preclinical
Molecular Formula: C25H30N4O3
Molecular Weight: 434.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCn1c(-c2ccc(O)c(O)c2)nc2cc3[nH]c(=O)c(C(C)C)nc3cc21
Standard InChI: InChI=1S/C25H30N4O3/c1-4-5-6-7-8-11-29-20-14-18-17(28-25(32)23(26-18)15(2)3)13-19(20)27-24(29)16-9-10-21(30)22(31)12-16/h9-10,12-15,30-31H,4-8,11H2,1-3H3,(H,28,32)
Standard InChI Key: GXJBSKCAFUXQDH-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
4.5920 -9.4877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2060 -9.1447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6540 -8.5316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8470 -8.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7402 -7.7111 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1441 -10.1008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9511 -9.9293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5031 -10.5424 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2481 -11.3270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4412 -11.4985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8891 -10.8854 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1862 -12.2832 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8002 -11.9401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5452 -12.7247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6072 -11.7686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8150 -6.5686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0304 -6.3136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8588 -5.5067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4719 -4.9546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2566 -5.2096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4281 -6.0165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3004 -4.1476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4547 -7.2986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1691 -7.7111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8836 -7.2986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5981 -7.7111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3125 -7.2986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0270 -7.7111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7415 -7.2986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0742 -5.2517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9865 -7.3755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4345 -7.9886 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9 13 1 0
31 5 1 0
13 14 1 0
5 3 1 0
13 15 1 0
6 7 2 0
31 16 1 0
3 4 1 0
16 17 2 0
6 1 1 0
17 18 1 0
1 4 2 0
18 19 2 0
19 20 1 0
3 2 2 0
20 21 2 0
21 16 1 0
2 7 1 0
19 22 1 0
6 11 1 0
5 23 1 0
7 8 1 0
23 24 1 0
8 9 2 0
24 25 1 0
9 10 1 0
25 26 1 0
10 11 1 0
27 26 1 0
4 32 1 0
27 28 1 0
10 12 2 0
28 29 1 0
32 31 2 0
18 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 434.54Molecular Weight (Monoisotopic): 434.2318AlogP: 5.44#Rotatable Bonds: 8Polar Surface Area: 104.03Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.89CX Basic pKa: 2.92CX LogP: 6.06CX LogD: 6.04Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.25Np Likeness Score: -0.38
References 1. Zhang L, Yan Y, Liu Z, Abliz Z, Liu G.. (2009) Identification of peptide substrate and small molecule inhibitors of testis-specific serine/threonine kinase1 (TSSK1) by the developed assays., 52 (14): [PMID:19530700 ] [10.1021/jm9002846 ]