2-(3,4-dihydroxyphenyl)-1-heptyl-7-isopropyl-1H-imidazo[4,5-g]quinoxalin-6(5H)-one

ID: ALA497880

PubChem CID: 135950293

Max Phase: Preclinical

Molecular Formula: C25H30N4O3

Molecular Weight: 434.54

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCn1c(-c2ccc(O)c(O)c2)nc2cc3[nH]c(=O)c(C(C)C)nc3cc21

Standard InChI:  InChI=1S/C25H30N4O3/c1-4-5-6-7-8-11-29-20-14-18-17(28-25(32)23(26-18)15(2)3)13-19(20)27-24(29)16-9-10-21(30)22(31)12-16/h9-10,12-15,30-31H,4-8,11H2,1-3H3,(H,28,32)

Standard InChI Key:  GXJBSKCAFUXQDH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    4.5920   -9.4877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2060   -9.1447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6540   -8.5316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8470   -8.7031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7402   -7.7111    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1441  -10.1008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9511   -9.9293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5031  -10.5424    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2481  -11.3270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4412  -11.4985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8891  -10.8854    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1862  -12.2832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8002  -11.9401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5452  -12.7247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6072  -11.7686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8150   -6.5686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0304   -6.3136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8588   -5.5067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4719   -4.9546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2566   -5.2096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4281   -6.0165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3004   -4.1476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4547   -7.2986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1691   -7.7111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8836   -7.2986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5981   -7.7111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3125   -7.2986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0270   -7.7111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7415   -7.2986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0742   -5.2517    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9865   -7.3755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4345   -7.9886    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  9 13  1  0
 31  5  1  0
 13 14  1  0
  5  3  1  0
 13 15  1  0
  6  7  2  0
 31 16  1  0
  3  4  1  0
 16 17  2  0
  6  1  1  0
 17 18  1  0
  1  4  2  0
 18 19  2  0
 19 20  1  0
  3  2  2  0
 20 21  2  0
 21 16  1  0
  2  7  1  0
 19 22  1  0
  6 11  1  0
  5 23  1  0
  7  8  1  0
 23 24  1  0
  8  9  2  0
 24 25  1  0
  9 10  1  0
 25 26  1  0
 10 11  1  0
 27 26  1  0
  4 32  1  0
 27 28  1  0
 10 12  2  0
 28 29  1  0
 32 31  2  0
 18 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA497880

    ---

Associated Targets(Human)

TSSK1B Tchem Testis-specific serine/threonine-protein kinase 1 (2038 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 434.54Molecular Weight (Monoisotopic): 434.2318AlogP: 5.44#Rotatable Bonds: 8
Polar Surface Area: 104.03Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.89CX Basic pKa: 2.92CX LogP: 6.06CX LogD: 6.04
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.25Np Likeness Score: -0.38

References

1. Zhang L, Yan Y, Liu Z, Abliz Z, Liu G..  (2009)  Identification of peptide substrate and small molecule inhibitors of testis-specific serine/threonine kinase1 (TSSK1) by the developed assays.,  52  (14): [PMID:19530700] [10.1021/jm9002846]

Source