N-[5-(4-Dimethylamino-phenyl)pyridin-2-yl]benzamide

ID: ALA498669

PubChem CID: 24949561

Max Phase: Preclinical

Molecular Formula: C20H19N3O

Molecular Weight: 317.39

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)c1ccc(-c2ccc(NC(=O)c3ccccc3)nc2)cc1

Standard InChI:  InChI=1S/C20H19N3O/c1-23(2)18-11-8-15(9-12-18)17-10-13-19(21-14-17)22-20(24)16-6-4-3-5-7-16/h3-14H,1-2H3,(H,21,22,24)

Standard InChI Key:  AISLOVNWEXVRGY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
    8.6277  -21.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6265  -22.8089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3416  -23.2219    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0584  -22.8084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0555  -21.9776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3398  -21.5682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7739  -23.2200    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4880  -22.8061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2035  -23.2177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2000  -24.0416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9147  -24.4531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6298  -24.0392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6259  -23.2095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9107  -22.8017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4867  -21.9808    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9148  -21.5688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9159  -20.7423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2019  -20.3299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4863  -20.7428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4891  -21.5725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2037  -21.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7707  -20.3312    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7694  -19.5058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0566  -20.7450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 11 12  2  0
  6  1  1  0
 12 13  1  0
  1  2  2  0
 13 14  2  0
 14  9  1  0
  4  7  1  0
  8 15  2  0
  3  4  2  0
  7  8  1  0
 16 17  2  0
 17 18  1  0
  8  9  1  0
 18 19  2  0
  4  5  1  0
 19 20  1  0
  9 10  2  0
 20 21  2  0
 21 16  1  0
  1 16  1  0
  2  3  1  0
 19 22  1  0
 10 11  1  0
 22 23  1  0
  5  6  2  0
 22 24  1  0
M  END

Alternative Forms

Associated Targets(non-human)

Luciferase (58 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 317.39Molecular Weight (Monoisotopic): 317.1528AlogP: 4.07#Rotatable Bonds: 4
Polar Surface Area: 45.23Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.66CX LogP: 4.20CX LogD: 4.20
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.79Np Likeness Score: -1.41

References

1. Heitman LH, van Veldhoven JP, Zweemer AM, Ye K, Brussee J, IJzerman AP..  (2008)  False positives in a reporter gene assay: identification and synthesis of substituted N-pyridin-2-ylbenzamides as competitive inhibitors of firefly luciferase.,  51  (15): [PMID:18646744] [10.1021/jm8004509]

Source