The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-(4-((2-amino-4-oxo-4,7-dihydro-3H-pyrrolo[2,3-d]pyrimidin-6-yl)methyl)benzamido)pentanedioic acid ID: ALA498800
PubChem CID: 136045806
Max Phase: Preclinical
Molecular Formula: C19H19N5O6
Molecular Weight: 413.39
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc2[nH]c(Cc3ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc3)cc2c(=O)[nH]1
Standard InChI: InChI=1S/C19H19N5O6/c20-19-23-15-12(17(28)24-19)8-11(21-15)7-9-1-3-10(4-2-9)16(27)22-13(18(29)30)5-6-14(25)26/h1-4,8,13H,5-7H2,(H,22,27)(H,25,26)(H,29,30)(H4,20,21,23,24,28)/t13-/m0/s1
Standard InChI Key: LHMUZCZEUVKRGD-ZDUSSCGKSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
-3.7851 1.0713 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.1682 0.3413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7315 -0.3529 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.9609 1.1072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5238 0.4057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9116 -0.3252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3349 -0.9148 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5930 -0.5523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7099 0.2654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5735 1.8373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9926 0.3089 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8630 -0.9355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1681 -0.4985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5594 -0.8827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2579 -0.4464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2272 0.3789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4922 0.7659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2033 0.3232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9255 0.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6561 0.4346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8934 1.6454 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3545 0.8768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0851 0.4904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3223 1.7011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0207 2.1390 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5917 2.0833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1172 -0.3340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8478 -0.7162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8799 -1.5406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5420 -0.2782 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
14 15 1 0
3 6 1 0
15 16 2 0
6 7 1 0
16 17 1 0
7 8 1 0
17 18 2 0
18 13 1 0
8 9 2 0
16 19 1 0
9 5 1 0
19 20 1 0
5 4 1 0
19 21 2 0
4 10 2 0
20 22 1 0
5 6 2 0
22 23 1 0
2 11 1 0
22 24 1 6
24 25 2 0
8 12 1 0
24 26 1 0
1 2 1 0
23 27 1 0
12 13 1 0
27 28 1 0
1 4 1 0
28 29 2 0
13 14 2 0
28 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 413.39Molecular Weight (Monoisotopic): 413.1335AlogP: 0.47#Rotatable Bonds: 8Polar Surface Area: 191.26Molecular Species: ACIDHBA: 6HBD: 6#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.36CX Basic pKa: 3.09CX LogP: -0.39CX LogD: -6.23Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.31Np Likeness Score: -0.01
References 1. Deng Y, Wang Y, Cherian C, Hou Z, Buck SA, Matherly LH, Gangjee A.. (2008) Synthesis and discovery of high affinity folate receptor-specific glycinamide ribonucleotide formyltransferase inhibitors with antitumor activity., 51 (16): [PMID:18680275 ] [10.1021/jm8003366 ]