The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E/Z)-3-epi-29-hydroxystelliferin E ID: ALA499485
PubChem CID: 21668739
Max Phase: Preclinical
Molecular Formula: C34H50O6
Molecular Weight: 554.77
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)O[C@@H](CC=C(C)C)/C(C)=C/C=C/C(C)=C1\C(=O)C[C@H]2[C@@]3(C)CC[C@@H](OC(C)=O)[C@](C)(CO)[C@@H]3CC[C@]12C
Standard InChI: InChI=1S/C34H50O6/c1-21(2)13-14-27(39-24(5)36)22(3)11-10-12-23(4)31-26(38)19-29-32(7)18-16-30(40-25(6)37)34(9,20-35)28(32)15-17-33(29,31)8/h10-13,27-30,35H,14-20H2,1-9H3/b12-10+,22-11+,31-23+/t27-,28+,29-,30+,32-,33-,34+/m0/s1
Standard InChI Key: ZFNWQRALNVEBDQ-AEJDOHNSSA-N
Molfile:
RDKit 2D
42 44 0 0 0 0 0 0 0 0999 V2000
9.2761 -10.0278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2761 -10.8573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9906 -11.2698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9906 -9.6107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7096 -10.0278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7107 -10.8573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4256 -11.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1441 -10.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4235 -9.6098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1439 -10.0286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7649 -9.4729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4282 -8.7105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5993 -8.7952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5617 -11.2698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8473 -10.8573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1329 -11.2698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8473 -10.0323 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9819 -12.0947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7015 -9.2029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8509 -10.4403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7015 -11.6777 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.0040 -8.8911 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.8429 -7.9973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5889 -9.4686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0050 -10.1809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9976 -8.7521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8226 -8.7478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2313 -8.0312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0562 -8.0269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4650 -7.3104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4725 -8.7392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2899 -7.3061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0489 -6.5981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6987 -6.5895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5236 -6.5852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9324 -5.8687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9398 -7.2975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2716 -11.6777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2670 -12.5027 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4576 -5.8816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0414 -5.1693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2826 -5.8773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10 20 1 6
3 6 1 0
6 21 1 6
5 4 1 0
9 22 1 1
5 6 1 0
12 23 2 0
11 24 2 0
1 2 1 0
24 25 1 0
10 11 1 0
24 26 1 0
11 12 1 0
26 27 2 0
12 13 1 0
27 28 1 0
13 9 1 0
28 29 2 0
1 4 1 0
29 30 1 0
2 14 1 6
29 31 1 0
2 3 1 0
30 32 1 0
14 15 1 0
30 33 1 1
5 9 1 0
32 34 1 0
15 16 1 0
34 35 2 0
6 7 1 0
35 36 1 0
15 17 2 0
35 37 1 0
7 8 1 0
3 38 1 1
3 18 1 0
38 39 1 0
8 10 1 0
33 40 1 0
5 19 1 1
40 41 2 0
9 10 1 0
40 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 554.77Molecular Weight (Monoisotopic): 554.3607AlogP: 6.83#Rotatable Bonds: 8Polar Surface Area: 89.90Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.41CX LogD: 5.41Aromatic Rings: ┄Heavy Atoms: 40QED Weighted: 0.15Np Likeness Score: 3.04
References 1. Meragelman KM, McKee TC, Boyd MR.. (2001) New cytotoxic isomalabaricane triterpenes from the sponge Jaspis species., 64 (3): [PMID:11277766 ] [10.1021/np000478g ]