The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-Amino-4-[(R)-2-benzyloxycarbonylsulfanyl-1-(carboxymethyl-carbamoyl)-ethylcarbamoyl]-butyric acid ID: ALA50249
PubChem CID: 44295373
Max Phase: Preclinical
Molecular Formula: C18H23N3O8S
Molecular Weight: 441.46
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N[C@@H](CCC(=O)N[C@@H](CSC(=O)OCc1ccccc1)C(=O)NCC(=O)O)C(=O)O
Standard InChI: InChI=1S/C18H23N3O8S/c19-12(17(26)27)6-7-14(22)21-13(16(25)20-8-15(23)24)10-30-18(28)29-9-11-4-2-1-3-5-11/h1-5,12-13H,6-10,19H2,(H,20,25)(H,21,22)(H,23,24)(H,26,27)/t12-,13-/m0/s1
Standard InChI Key: ASKLIFLGJJZFTM-STQMWFEESA-N
Molfile:
RDKit 2D
30 30 0 0 1 0 0 0 0 0999 V2000
6.0792 -1.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4917 -1.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6167 -2.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4917 -0.3042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6000 0.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0792 0.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0792 -2.4500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5667 -1.4792 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.0792 -3.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2542 -1.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3542 -2.6667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3250 -1.7292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0125 -0.3042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9250 -2.7542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0125 1.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4917 1.1250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2542 -3.8792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4917 -3.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8417 1.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2542 0.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7667 0.4083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6000 1.8333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4917 -4.5917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9667 -3.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2792 -4.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5417 -3.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3250 -4.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6292 -5.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8500 -4.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8917 -4.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 8 1 0
1 4 1 6
5 15 1 0
6 4 1 0
7 2 1 0
8 10 1 0
9 18 1 0
10 1 1 0
11 3 2 0
12 2 2 0
13 5 2 0
14 3 1 0
15 19 1 0
16 6 2 0
17 9 2 0
18 7 1 0
19 20 1 0
20 6 1 0
21 5 1 0
15 22 1 1
23 9 1 0
24 14 1 0
25 24 1 0
26 25 2 0
27 25 1 0
28 27 2 0
29 26 1 0
30 28 1 0
30 29 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 441.46Molecular Weight (Monoisotopic): 441.1206AlogP: -0.07#Rotatable Bonds: 12Polar Surface Area: 185.12Molecular Species: ZWITTERIONHBA: 8HBD: 5#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 1.71CX Basic pKa: 9.31CX LogP: -2.79CX LogD: -6.04Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.28Np Likeness Score: 0.37
References 1. Hsu YR, Norton SJ.. (1983) S-carbobenzoxyglutathione: a competitive inhibitor of mammalian glyoxalase II., 26 (12): [PMID:6644749 ] [10.1021/jm00366a027 ]