The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-Benzylamino-7-isopropyl-6-oxo-6,7-dihydro-5H-5,7a,12-triaza-dibenzo[a,e]azulene-10-carboxylic acid methyl-(1-methyl-piperidin-4-yl)-amide ID: ALA503688
PubChem CID: 136036259
Max Phase: Preclinical
Molecular Formula: C33H38N6O2
Molecular Weight: 550.71
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)[C@H]1C(=O)Nc2ccc(NCc3ccccc3)cc2-c2nc3cc(C(=O)N(C)C4CCN(C)CC4)ccc3n21
Standard InChI: InChI=1S/C33H38N6O2/c1-21(2)30-32(40)36-27-12-11-24(34-20-22-8-6-5-7-9-22)19-26(27)31-35-28-18-23(10-13-29(28)39(30)31)33(41)38(4)25-14-16-37(3)17-15-25/h5-13,18-19,21,25,30,34H,14-17,20H2,1-4H3,(H,36,40)/t30-/m0/s1
Standard InChI Key: PKXKCWSYPLCFKQ-PMERELPUSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
8.0352 -0.2948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0799 -1.1186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3889 -1.5692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2994 0.0783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6084 -0.3723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6531 -1.1961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8111 -0.1603 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7074 -2.2992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9675 -2.6641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2209 -2.3131 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8834 -1.4932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3630 -0.8530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5381 -0.8608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0298 -1.5106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2129 -1.3953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9043 -0.6301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4126 0.0197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2295 -0.0957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9752 -3.4891 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7262 0.1558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6815 0.9796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4620 -0.2173 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5068 -1.0411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1531 0.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1084 1.0571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7994 1.5077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5352 1.1346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5799 0.3108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8889 -0.1399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2262 1.5852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3572 -2.8075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1223 -2.4989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2419 -3.6244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1040 0.7848 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2871 0.9001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9785 1.6652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1616 1.7805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8530 2.5456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3613 3.1954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1782 3.0801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4868 2.3150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9 19 2 0
4 1 1 0
1 20 1 0
5 6 1 0
20 21 2 0
20 22 1 0
8 9 1 0
22 23 1 0
9 10 1 0
22 24 1 0
24 25 1 0
8 11 1 0
12 13 1 0
14 10 1 0
11 12 1 0
2 3 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
3 6 2 0
27 30 1 0
13 14 2 0
8 31 1 1
6 11 1 0
31 32 1 0
14 15 1 0
31 33 1 0
12 7 2 0
17 34 1 0
15 16 2 0
34 35 1 0
7 5 1 0
35 36 1 0
16 17 1 0
36 37 2 0
1 2 2 0
37 38 1 0
17 18 2 0
38 39 2 0
18 13 1 0
39 40 1 0
5 4 2 0
40 41 2 0
41 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 550.71Molecular Weight (Monoisotopic): 550.3056AlogP: 5.63#Rotatable Bonds: 6Polar Surface Area: 82.50Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.95CX Basic pKa: 8.51CX LogP: 4.43CX LogD: 3.28Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.33Np Likeness Score: -1.12
References 1. Malik L, Kelly NM, Ma JN, Currier EA, Burstein ES, Olsson R.. (2009) Discovery of non-peptidergic MrgX1 and MrgX2 receptor agonists and exploration of an initial SAR using solid-phase synthesis., 19 (6): [PMID:19230660 ] [10.1016/j.bmcl.2009.01.085 ]