The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Rohitiukin ID: ALA505243
PubChem CID: 44575181
Max Phase: Preclinical
Molecular Formula: C34H42O13
Molecular Weight: 658.70
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Rohitiukin | Rohitiukin|CHEMBL505243
Canonical SMILES: C=C1[C@H]([C@@]2(C)[C@@H](OC(C)=O)CC(=O)O[C@]3(C)COC(=O)C[C@H]23)[C@@H](OC=O)[C@H](OC(=O)CC(C)C)[C@@]2(C)[C@@H](c3ccoc3)CC(=O)[C@@]12O
Standard InChI: InChI=1S/C34H42O13/c1-17(2)10-26(39)46-30-29(44-16-35)28(18(3)34(41)23(37)11-21(33(30,34)7)20-8-9-42-14-20)32(6)22-12-25(38)43-15-31(22,5)47-27(40)13-24(32)45-19(4)36/h8-9,14,16-17,21-22,24,28-30,41H,3,10-13,15H2,1-2,4-7H3/t21-,22+,24+,28+,29-,30+,31-,32-,33-,34+/m1/s1
Standard InChI Key: BGIQNWKPRGQOMD-PPSVOAGPSA-N
Molfile:
RDKit 2D
49 53 0 0 0 0 0 0 0 0999 V2000
0.2398 -25.4641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9837 -25.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7357 -25.4839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0509 -26.2730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5593 -26.9186 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7599 -26.4435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7262 -24.6607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7455 -23.2120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7455 -24.0329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4559 -24.4453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4559 -22.7921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1706 -23.2120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1762 -24.0322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9592 -24.2834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4355 -23.6184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9532 -22.9490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2003 -22.1686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9798 -21.9094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9796 -21.0853 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1932 -20.8342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7126 -21.5037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2128 -25.0674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1678 -24.8559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1635 -22.3858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4555 -21.9730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8516 -21.2560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6821 -21.2410 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4382 -20.5444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8409 -19.8236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4177 -19.1183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6654 -19.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0236 -22.8042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3171 -23.2169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3168 -24.0474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4585 -25.2701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7154 -24.8670 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.9082 -26.2836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3793 -26.9283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6836 -27.6997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4937 -27.8322 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0186 -27.1940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7263 -26.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8638 -27.3296 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7795 -27.5312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5371 -25.7485 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.9908 -24.2660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2532 -23.8330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2602 -22.9739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4916 -24.2548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
1 4 1 0
3 37 1 0
4 5 1 0
5 38 1 0
4 6 2 0
3 7 1 1
8 9 1 0
8 11 1 0
9 10 1 0
10 13 1 0
12 11 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 12 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 2 0
21 17 1 0
16 17 1 1
14 22 2 0
13 23 1 6
12 24 1 6
11 25 1 6
25 26 1 0
26 27 2 0
26 28 1 0
28 29 1 0
29 30 1 0
29 31 1 0
8 32 1 1
32 33 1 0
33 34 2 0
10 35 2 0
3 9 1 0
9 36 1 1
37 38 1 0
37 42 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
41 43 2 0
38 44 1 6
37 45 1 6
2 46 1 6
46 47 1 0
47 48 1 0
47 49 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 658.70Molecular Weight (Monoisotopic): 658.2625AlogP: 2.97#Rotatable Bonds: 8Polar Surface Area: 181.94Molecular Species: NEUTRALHBA: 13HBD: 1#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.10CX Basic pKa: ┄CX LogP: 2.28CX LogD: 2.28Aromatic Rings: 1Heavy Atoms: 47QED Weighted: 0.19Np Likeness Score: 2.94
References 1. Lidert Z, Taylor DAH, Thirugnanam M. (1985) Insect Antifeedant Activity of Four Prieurianin-Type Limonoids, 48 (5): [10.1021/np50041a029 ]