The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-7-sec-Butyl-6-oxo-2-(2-piperidin-1-yl-ethylamino)-6,7-dihydro-5H-5,7a,12-triaza-dibenzo[a,e]azulene-10-carboxylic acid 3-trifluoromethyl-benzylamide ID: ALA505263
PubChem CID: 136036261
Max Phase: Preclinical
Molecular Formula: C35H39F3N6O2
Molecular Weight: 632.73
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC(C)[C@H]1C(=O)Nc2ccc(NCCN3CCCCC3)cc2-c2nc3cc(C(=O)NCc4cccc(C(F)(F)F)c4)ccc3n21
Standard InChI: InChI=1S/C35H39F3N6O2/c1-3-22(2)31-34(46)42-28-12-11-26(39-14-17-43-15-5-4-6-16-43)20-27(28)32-41-29-19-24(10-13-30(29)44(31)32)33(45)40-21-23-8-7-9-25(18-23)35(36,37)38/h7-13,18-20,22,31,39H,3-6,14-17,21H2,1-2H3,(H,40,45)(H,42,46)/t22?,31-/m0/s1
Standard InChI Key: FAYLESWWEBZCNO-NMBPHSMGSA-N
Molfile:
RDKit 2D
47 52 0 0 0 0 0 0 0 0999 V2000
8.1297 -9.6071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1744 -10.4309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4834 -10.8815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3939 -9.2339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7029 -9.6846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7476 -10.5084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9056 -9.4726 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8019 -11.6115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0620 -11.9764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3154 -11.6254 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9780 -10.8055 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4576 -10.1653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6326 -10.1730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1243 -10.8228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3074 -10.7075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9988 -9.9424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5071 -9.2926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3240 -9.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0697 -12.8013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8208 -9.1565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7760 -8.3327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5565 -9.5296 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4517 -12.1198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3364 -12.9367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2168 -11.8112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1985 -8.5275 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8666 -12.3195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2476 -9.0790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9834 -9.4521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6744 -9.0015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4102 -9.3747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4550 -10.1984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7639 -10.6491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0281 -10.2759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1013 -8.9240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7923 -8.4734 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.6506 -8.2330 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.5519 -9.6151 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.7172 -12.4321 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.7068 -7.8777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3982 -7.1126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5813 -6.9973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0730 -7.6471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2561 -7.5318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9475 -6.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4558 -6.1169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2727 -6.2322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20 22 1 0
8 9 1 0
8 23 1 1
9 10 1 0
23 24 1 0
8 11 1 0
23 25 1 0
12 13 1 0
17 26 1 0
14 10 1 0
25 27 1 0
11 12 1 0
22 28 1 0
2 3 1 0
28 29 1 0
3 6 2 0
29 30 2 0
13 14 2 0
30 31 1 0
6 11 1 0
31 32 2 0
14 15 1 0
32 33 1 0
12 7 2 0
33 34 2 0
34 29 1 0
15 16 2 0
31 35 1 0
7 5 1 0
35 36 1 0
16 17 1 0
35 37 1 0
1 2 2 0
35 38 1 0
17 18 2 0
8 39 1 6
18 13 1 0
26 40 1 0
5 4 2 0
40 41 1 0
9 19 2 0
41 42 1 0
42 43 1 0
4 1 1 0
1 20 1 0
5 6 1 0
20 21 2 0
42 47 1 0
43 44 1 0
44 45 1 0
45 46 1 0
46 47 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 632.73Molecular Weight (Monoisotopic): 632.3087AlogP: 7.09#Rotatable Bonds: 9Polar Surface Area: 91.29Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.94CX Basic pKa: 9.07CX LogP: 6.37CX LogD: 4.69Aromatic Rings: 4Heavy Atoms: 46QED Weighted: 0.18Np Likeness Score: -1.31
References 1. Malik L, Kelly NM, Ma JN, Currier EA, Burstein ES, Olsson R.. (2009) Discovery of non-peptidergic MrgX1 and MrgX2 receptor agonists and exploration of an initial SAR using solid-phase synthesis., 19 (6): [PMID:19230660 ] [10.1016/j.bmcl.2009.01.085 ]