The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Nodulisporic acid D2 methyl ester ID: ALA505385
PubChem CID: 11319629
Max Phase: Preclinical
Molecular Formula: C39H53NO6
Molecular Weight: 631.85
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Nodulisporic Acid D2 Methyl Ester | CHEMBL505385|Nodulisporic acid D2 methyl ester
Canonical SMILES: COC(=O)[C@@H](C)[C@@H](O)[C@@H]1C[C@@]2(C)[C@@H]3CC[C@H]4Cc5c([nH]c6cc7c(cc56)C5=CC(C)(C)OC(C)(C)[C@H]5C7)[C@]4(C)[C@@]3(C)CC[C@]2(O)O1
Standard InChI: InChI=1S/C39H53NO6/c1-20(33(42)44-9)31(41)29-19-37(7)30-11-10-22-16-25-24-17-23-21(14-27-26(23)18-34(2,3)46-35(27,4)5)15-28(24)40-32(25)38(22,8)36(30,6)12-13-39(37,43)45-29/h15,17-18,20,22,27,29-31,40-41,43H,10-14,16,19H2,1-9H3/t20-,22-,27-,29-,30+,31+,36-,37-,38+,39-/m0/s1
Standard InChI Key: LGRXZPOYTCHPCH-DSOITLKOSA-N
Molfile:
RDKit 2D
50 57 0 0 0 0 0 0 0 0999 V2000
9.0273 -8.4207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5551 -9.0998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9082 -9.8476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8525 -8.4853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2024 -9.2393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7349 -9.9178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2353 -10.5699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9912 -9.4698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0142 -10.2949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7357 -10.6861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6878 -9.0426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4101 -9.4280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4359 -10.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2293 -10.4837 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5911 -10.6322 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.1532 -10.1908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8323 -10.6671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0957 -7.5897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2445 -8.1365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1886 -9.1466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6915 -9.7986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6568 -8.4658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4482 -8.7012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4641 -9.5261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8663 -8.6690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1438 -8.2734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4387 -7.8702 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
14.4558 -10.3488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8863 -9.4938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1874 -9.9124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1998 -10.7272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9129 -11.1245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1802 -9.0817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8789 -10.3210 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
16.5947 -9.0561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6048 -9.8858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6164 -10.7013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3956 -10.9423 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.8657 -10.2756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3769 -9.6227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6101 -11.5263 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.6934 -10.2637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1175 -10.9746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0775 -9.4694 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
19.0970 -9.5410 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7140 -11.6974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9452 -10.9628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3708 -11.6725 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.3503 -10.2389 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1985 -11.6588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12 13 1 0
13 14 1 0
14 21 1 0
20 12 1 0
6 15 1 1
3 16 1 0
3 17 1 0
1 18 1 0
1 19 1 0
20 21 2 0
21 24 1 0
23 22 1 0
22 20 1 0
23 24 1 0
23 26 1 0
24 30 1 0
29 25 1 0
25 26 1 0
23 27 1 1
24 28 1 6
29 30 1 0
29 36 1 0
30 31 1 0
31 32 1 0
32 37 1 0
30 33 1 1
29 34 1 6
36 35 1 1
36 37 1 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 36 1 0
5 4 2 0
37 41 1 6
5 6 1 0
39 42 1 0
6 7 1 0
42 43 1 0
7 9 1 0
39 44 1 6
8 5 1 0
42 45 1 6
8 9 2 0
43 46 1 1
9 10 1 0
43 47 1 0
10 13 2 0
12 11 2 0
47 48 1 0
47 49 2 0
11 8 1 0
48 50 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 631.85Molecular Weight (Monoisotopic): 631.3873AlogP: 6.60#Rotatable Bonds: 3Polar Surface Area: 101.01Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.66CX Basic pKa: ┄CX LogP: 6.22CX LogD: 6.22Aromatic Rings: 2Heavy Atoms: 46QED Weighted: 0.33Np Likeness Score: 2.72
References 1. Singh SB, Ondeyka JG, Jayasuriya H, Zink DL, Ha SN, Dahl-Roshak A, Greene J, Kim JA, Smith MM, Shoop W, Tkacz JS.. (2004) Nodulisporic acids D-F: structure, biological activities, and biogenetic relationships., 67 (9): [PMID:15387649 ] [10.1021/np0498455 ]