The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3R,5S)-5-((4-(3-chloro-4-(3-fluorobenzyloxy)phenylamino)thieno[3,2-d]pyrimidin-6-yl)ethynyl)pyrrolidin-3-yl diethylcarbamate ID: ALA505626
PubChem CID: 11490270
Max Phase: Preclinical
Molecular Formula: C30H29ClFN5O3S
Molecular Weight: 594.11
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)C(=O)O[C@H]1CN[C@H](C#Cc2cc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c3s2)C1
Standard InChI: InChI=1S/C30H29ClFN5O3S/c1-3-37(4-2)30(38)40-23-13-21(33-16-23)8-10-24-15-26-28(41-24)29(35-18-34-26)36-22-9-11-27(25(31)14-22)39-17-19-6-5-7-20(32)12-19/h5-7,9,11-12,14-15,18,21,23,33H,3-4,13,16-17H2,1-2H3,(H,34,35,36)/t21-,23-/m1/s1
Standard InChI Key: GWKMIVYJIGCSBU-FYYLOGMGSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
-2.3314 -18.3476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5437 -18.5933 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0666 -17.9202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5596 -17.2584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3411 -17.5227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2417 -17.9105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0143 -17.0457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7640 -17.3901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4371 -16.9132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8405 -18.2117 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5822 -17.9083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4072 -17.9083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8921 -18.5757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8921 -17.2408 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.6768 -17.4956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6743 -18.3189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3849 -18.7309 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0985 -18.3208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0970 -17.4943 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3858 -17.0861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3847 -16.2610 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0986 -15.8475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8114 -16.2619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5249 -15.8491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5242 -15.0231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8041 -14.6118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0936 -15.0270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2397 -16.2610 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.2376 -14.6087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9532 -15.0194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6666 -14.6050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3794 -15.0200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0923 -14.6063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0905 -13.7804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3699 -13.3699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6599 -13.7861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8077 -15.0173 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.3606 -16.0916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1868 -17.2577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8600 -16.7806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0338 -15.6146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19 20 2 0
20 15 1 0
8 10 2 0
20 21 1 0
5 1 1 0
21 22 1 0
6 11 3 0
22 23 2 0
1 2 1 0
23 24 1 0
11 12 1 0
24 25 2 0
12 13 2 0
25 26 1 0
3 6 1 1
26 27 2 0
27 22 1 0
24 28 1 0
13 16 1 0
25 29 1 0
15 14 1 0
29 30 1 0
14 12 1 0
30 31 1 0
5 7 1 6
31 32 2 0
2 3 1 0
32 33 1 0
15 16 2 0
33 34 2 0
7 8 1 0
34 35 1 0
16 17 1 0
35 36 2 0
36 31 1 0
3 4 1 0
33 37 1 0
17 18 2 0
9 38 1 0
8 9 1 0
9 39 1 0
18 19 1 0
39 40 1 0
4 5 1 0
38 41 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 594.11Molecular Weight (Monoisotopic): 593.1664AlogP: 6.37#Rotatable Bonds: 8Polar Surface Area: 88.61Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.25CX LogP: 6.41CX LogD: 5.51Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.23Np Likeness Score: -1.17
References 1. Stevens KL, Alligood KJ, Alberti JG, Caferro TR, Chamberlain SD, Dickerson SH, Dickson HD, Emerson HK, Griffin RJ, Hubbard RD, Keith BR, Mullin RJ, Petrov KG, Gerding RM, Reno MJ, Rheault TR, Rusnak DW, Sammond DM, Smith SC, Uehling DE, Waterson AG, Wood ER.. (2009) Synthesis and stereochemical effects of pyrrolidinyl-acetylenic thieno[3,2-d]pyrimidines as EGFR and ErbB-2 inhibitors., 19 (1): [PMID:19028424 ] [10.1016/j.bmcl.2008.11.023 ]