The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
musidunin ID: ALA506974
PubChem CID: 44583803
Max Phase: Preclinical
Molecular Formula: C31H38O11
Molecular Weight: 586.63
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Musidunin | musidunin|CHEMBL506974
Canonical SMILES: COC(=O)C[C@H]1C(C)(C)O[C@@]23OCC4=C5[C@H](O)C[C@@H](c6ccco6)[C@]5(C)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]4[C@@]12CCC3=O
Standard InChI: InChI=1S/C31H38O11/c1-15(32)40-26-25-17(24-19(34)12-18(20-8-7-11-38-20)29(24,5)27(26)41-16(2)33)14-39-31-22(35)9-10-30(25,31)21(13-23(36)37-6)28(3,4)42-31/h7-8,11,18-19,21,25-27,34H,9-10,12-14H2,1-6H3/t18-,19+,21-,25+,26+,27-,29-,30+,31+/m0/s1
Standard InChI Key: WZDPDLRZUKEIJA-ODKKIPFQSA-N
Molfile:
RDKit 2D
44 49 0 0 0 0 0 0 0 0999 V2000
-1.0047 -11.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7168 -11.0050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9887 -10.5994 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5000 -11.2641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5074 -9.9293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7253 -10.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7326 -8.8504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5118 -9.1084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3251 -9.5590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0047 -9.7632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2944 -10.1829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2794 -8.5358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0004 -8.9404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4308 -8.9555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4248 -9.7760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2033 -10.0353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6905 -9.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2131 -8.7078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4696 -7.9221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2561 -7.6729 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2622 -6.8480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4793 -6.5871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9896 -7.2512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4524 -10.8218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2703 -7.7108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9802 -7.2903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9710 -6.4653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6992 -7.6949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4209 -8.2214 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2460 -8.2261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6626 -7.5139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8335 -8.8089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3377 -9.1006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3002 -11.4758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5044 -12.0883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7209 -11.8300 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.9251 -9.3381 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5125 -9.3798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0024 -12.2383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2866 -12.6488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7156 -12.6530 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4267 -12.2341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0126 -10.5882 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.4250 -8.1298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10 11 1 0
3 4 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 19 2 0
18 19 1 6
4 2 1 0
16 24 1 1
5 6 1 0
12 25 1 6
2 6 1 0
25 26 1 0
10 13 1 0
26 27 1 0
11 15 2 0
26 28 2 0
14 12 1 0
13 29 1 1
12 13 1 0
29 30 1 0
14 15 1 0
30 31 2 0
30 32 1 0
6 10 1 0
8 33 2 0
2 1 1 0
4 34 1 0
7 8 1 0
4 35 1 0
8 5 1 0
2 36 1 6
15 16 1 0
5 37 1 1
16 17 1 0
11 38 1 0
37 38 1 0
17 18 1 0
1 39 1 0
18 14 1 0
39 40 1 0
19 20 1 0
39 41 2 0
6 9 1 6
40 42 1 0
5 3 1 0
10 43 1 6
7 9 1 0
14 44 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 586.63Molecular Weight (Monoisotopic): 586.2414AlogP: 2.99#Rotatable Bonds: 5Polar Surface Area: 147.80Molecular Species: NEUTRALHBA: 11HBD: 1#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 1.38CX LogD: 1.38Aromatic Rings: 1Heavy Atoms: 42QED Weighted: 0.31Np Likeness Score: 2.46
References 1. Nihei K, Asaka Y, Mine Y, Yamada Y, Iigo M, Yanagisawa T, Kubo I.. (2006) Musidunin and musiduol, insect antifeedants from Croton jatrophoides., 69 (6): [PMID:16792423 ] [10.1021/np060068d ]