3alpha-Cinnamoyloxy-N-(3-(4-hydroxyphenyl)propanoyl)nortropane

ID: ALA5069926

PubChem CID: 166625706

Max Phase: Preclinical

Molecular Formula: C25H27NO4

Molecular Weight: 405.49

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(/C=C/c1ccccc1)OC1CC2CCC(C1)N2C(=O)CCc1ccc(O)cc1

Standard InChI:  InChI=1S/C25H27NO4/c27-22-12-6-19(7-13-22)8-14-24(28)26-20-10-11-21(26)17-23(16-20)30-25(29)15-9-18-4-2-1-3-5-18/h1-7,9,12-13,15,20-21,23,27H,8,10-11,14,16-17H2/b15-9+

Standard InChI Key:  FPAPOJFPIYGOGV-OQLLNIDSSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   20.8890   -6.5637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9637   -7.3661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4440   -6.9377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4677   -6.9377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3292   -6.1211    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.8224   -6.5456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3326   -7.9316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8555   -7.4056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9569   -8.1802    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.6611   -8.5947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6543   -9.4118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3722   -8.1920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0765   -8.6065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7876   -8.2039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4890   -8.6193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1996   -8.2173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2069   -7.3992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4977   -6.9849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7900   -7.3892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9126   -5.4181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3131   -4.7058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0954   -5.4273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6949   -6.1396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8777   -6.1489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4635   -5.4472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6471   -5.4561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2458   -6.1690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6668   -6.8743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4818   -6.8619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4286   -6.1793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  1  6  1  0
  6  2  1  0
  4  7  1  0
  1  8  1  0
  7  8  1  0
  2  9  1  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
  5 20  1  0
 20 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 27 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5069926

    ---

Associated Targets(non-human)

Trachea (249 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 405.49Molecular Weight (Monoisotopic): 405.1940AlogP: 4.10#Rotatable Bonds: 6
Polar Surface Area: 66.84Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.51CX Basic pKa: CX LogP: 4.27CX LogD: 4.27
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.58Np Likeness Score: 0.48

References

1. Chan ZY, Krishnan P, Modaresi SM, Hii LW, Mai CW, Lim WM, Leong CO, Low YY, Wong SK, Yong KT, Leong AZ, Lee MK, Ting KN, Lim KH..  (2021)  Monomeric, Dimeric, and Trimeric Tropane Alkaloids from Pellacalyx saccardianus.,  84  (8.0): [PMID:34342431] [10.1021/acs.jnatprod.1c00374]

Source