The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3,5-bis(trifluoromethyl)phenyl)-3-((1S)-(6-methoxyquinolin-4-yl)(8-vinylquinuclidin-2-yl)methyl)thiourea ID: ALA5070688
PubChem CID: 59806289
Max Phase: Preclinical
Molecular Formula: C29H28F6N4OS
Molecular Weight: 594.63
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC1CN2CCC1CC2[C@@H](NC(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccnc2ccc(OC)cc12
Standard InChI: InChI=1S/C29H28F6N4OS/c1-3-16-15-39-9-7-17(16)10-25(39)26(22-6-8-36-24-5-4-21(40-2)14-23(22)24)38-27(41)37-20-12-18(28(30,31)32)11-19(13-20)29(33,34)35/h3-6,8,11-14,16-17,25-26H,1,7,9-10,15H2,2H3,(H2,37,38,41)/t16?,17?,25?,26-/m0/s1
Standard InChI Key: IQMKPBFOEWWDIQ-STGLZICKSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
17.9486 -4.8628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2309 -4.5323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2432 -4.2851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4250 -4.8776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9002 -3.5796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4147 -3.8890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6855 -4.2199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4149 -3.0291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6086 -4.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6110 -5.6047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0216 -4.7861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3145 -4.3812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0218 -5.6041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3160 -6.0057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3136 -6.8128 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0201 -7.2262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7248 -6.8105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7217 -6.0054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3108 -3.5675 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6032 -3.1649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4267 -5.6004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1310 -6.0027 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.7151 -2.2690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5234 -2.1489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1348 -6.8198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8444 -7.2251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.4290 -7.2317 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
18.5502 -6.8133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2552 -7.2219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9606 -6.8107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9572 -5.9927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2426 -5.5875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5402 -6.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2359 -4.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9403 -4.3560 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.5249 -4.3676 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.2288 -3.9498 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.6700 -7.2164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6734 -8.0335 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.3760 -6.8048 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.3749 -7.6230 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
2 4 1 0
2 5 1 0
3 6 1 0
4 7 1 0
5 8 1 0
6 7 1 0
6 8 1 0
9 10 2 0
10 14 1 0
13 11 1 0
11 12 2 0
12 9 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 13 2 0
12 19 1 0
19 20 1 0
18 21 1 0
21 22 1 1
21 4 1 0
8 23 1 0
23 24 2 0
22 25 1 0
25 26 1 0
25 27 2 0
26 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
32 34 1 0
34 35 1 0
34 36 1 0
34 37 1 0
30 38 1 0
38 39 1 0
38 40 1 0
38 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 594.63Molecular Weight (Monoisotopic): 594.1888AlogP: 7.21#Rotatable Bonds: 6Polar Surface Area: 49.42Molecular Species: BASEHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.27CX Basic pKa: 8.53CX LogP: 6.78CX LogD: 5.62Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.18Np Likeness Score: -0.47
References 1. Jin PR, Ta YN, Chen IT, Yu YN, Hsieh HT, Nguyen VT, Hsieh SY, Hsia T, Liu H, Hsu CW, Han JL, Chen Y.. (2021) Cinchona Alkaloid-Inspired Urea-Containing Autophagy Inhibitor Shows Single-Agent Anticancer Efficacy., 64 (19.0): [PMID:34558909 ] [10.1021/acs.jmedchem.1c01036 ]