The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-amino-7-oxo-2-p-tolyl-6,7-dihydro-2H-pyrazolo[4,3-d]pyridazin-3-yl)-3-methyl-N-(3-(trifluoromethyl)phenyl)benzofuran-6-carboxamide ID: ALA5072528
PubChem CID: 166630707
Max Phase: Preclinical
Molecular Formula: C29H21F3N6O3
Molecular Weight: 558.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(-n2nc3c(=O)[nH]nc(N)c3c2-c2oc3cc(C(=O)Nc4cccc(C(F)(F)F)c4)ccc3c2C)cc1
Standard InChI: InChI=1S/C29H21F3N6O3/c1-14-6-9-19(10-7-14)38-24(22-23(37-38)28(40)36-35-26(22)33)25-15(2)20-11-8-16(12-21(20)41-25)27(39)34-18-5-3-4-17(13-18)29(30,31)32/h3-13H,1-2H3,(H2,33,35)(H,34,39)(H,36,40)
Standard InChI Key: IVOLVWXPNJAPBS-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
23.9049 -15.6628 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.9049 -16.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3155 -15.6628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6102 -15.2501 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3155 -16.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6159 -16.8863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7861 -17.6772 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.5910 -17.7598 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.9180 -17.0198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7161 -16.8464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3248 -17.3916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0466 -16.0991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.8595 -16.1823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0289 -16.9781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8013 -17.2278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4051 -16.6827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2312 -15.8847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4590 -15.6387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8355 -15.3346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6141 -15.5829 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.6613 -14.5362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.2435 -18.2048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0244 -15.2563 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.1981 -16.8902 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.2184 -15.0328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9958 -15.2836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5997 -14.7343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4258 -13.9350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6424 -13.6879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0417 -14.2389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0009 -18.4647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5925 -19.1738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0022 -19.8799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8203 -19.8782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2268 -19.1645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8147 -18.4612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4653 -12.8901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0677 -12.3379 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.6859 -12.6445 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.2472 -12.0969 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.2317 -20.5843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 6 1 0
5 3 1 0
3 4 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 1 0
9 5 2 0
10 11 2 0
11 14 1 0
13 12 1 0
12 10 1 0
9 10 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
17 19 1 0
19 20 1 0
19 21 2 0
11 22 1 0
3 23 1 0
2 24 2 0
20 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
8 31 1 0
29 37 1 0
37 38 1 0
37 39 1 0
37 40 1 0
34 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 558.52Molecular Weight (Monoisotopic): 558.1627AlogP: 5.99#Rotatable Bonds: 4Polar Surface Area: 131.83Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.72CX Basic pKa: 0.75CX LogP: 5.30CX LogD: 5.28Aromatic Rings: 6Heavy Atoms: 41QED Weighted: 0.24Np Likeness Score: -1.30
References 1. Tan X, Li C, Yang R, Zhao S, Li F, Li X, Chen L, Wan X, Liu X, Yang T, Tong X, Xu T, Cui R, Jiang H, Zhang S, Liu H, Zheng M.. (2022) Discovery of Pyrazolo[3,4-d ]pyridazinone Derivatives as Selective DDR1 Inhibitors via Deep Learning Based Design, Synthesis, and Biological Evaluation., 65 (1.0): [PMID:34821145 ] [10.1021/acs.jmedchem.1c01205 ]