N-(4-((3-(trifluoromethyl)phenyl)sulfonamido)phenyl)-5-nitrofuran-2-carboxamide

ID: ALA5072845

PubChem CID: 166630555

Max Phase: Preclinical

Molecular Formula: C18H12F3N3O6S

Molecular Weight: 455.37

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(NS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1)c1ccc([N+](=O)[O-])o1

Standard InChI:  InChI=1S/C18H12F3N3O6S/c19-18(20,21)11-2-1-3-14(10-11)31(28,29)23-13-6-4-12(5-7-13)22-17(25)15-8-9-16(30-15)24(26)27/h1-10,23H,(H,22,25)

Standard InChI Key:  GWNFURCPOFWHQG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
   50.4925  -18.5395    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   50.2820  -17.7512    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   49.7046  -18.3276    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.5493  -20.0377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.3665  -20.0377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.6208  -19.2610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9579  -18.7789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.2991  -19.2610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5195  -19.0066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.9124  -19.5537    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.3492  -18.2073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   46.3984  -19.0096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.0049  -19.5572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   46.5694  -18.2105    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   47.3469  -17.9590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.9518  -18.5080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   48.7287  -18.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   48.9003  -17.4573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   48.2889  -16.9087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.5143  -17.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   49.6775  -17.2048    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   51.0620  -17.4991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   51.6664  -18.0487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   52.4458  -17.7972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   52.6181  -16.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   52.0049  -16.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   51.2279  -16.6990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   52.1732  -15.6450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   52.9499  -15.3909    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   51.3799  -15.4276    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   51.9577  -14.8498    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  4  2  0
  9 10  2  0
  9 11  1  0
  8  9  1  0
  6 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 18 21  1  0
 21  2  1  0
  2 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 26 28  1  0
 28 29  1  0
 28 30  1  0
 28 31  1  0
M  CHG  2   9   1  11  -1
M  END

Alternative Forms

  1. Parent:

    ALA5072845

    ---

Associated Targets(non-human)

Slc14a1 Urea transporter 1 (102 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Slc14a1 Urea transporter 1 (62 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 455.37Molecular Weight (Monoisotopic): 455.0399AlogP: 4.26#Rotatable Bonds: 6
Polar Surface Area: 131.55Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.80CX Basic pKa: CX LogP: 3.52CX LogD: 3.40
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.42Np Likeness Score: -2.19

References

1. Wang S, Xu Y, Zhao Y, Zhang S, Li M, Li X, He J, Zhou H, Ge Z, Li R, Yang B..  (2021)  N-(4-acetamidophenyl)-5-acetylfuran-2-carboxamide as a novel orally available diuretic that targets urea transporters with improved PD and PK properties.,  226  [PMID:34601246] [10.1016/j.ejmech.2021.113859]

Source