4alpha-Phorbol 12,13-dioctanoate

ID: ALA507303

PubChem CID: 42638083

Max Phase: Preclinical

Molecular Formula: C36H56O8

Molecular Weight: 616.84

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: 4Alpha-Phorbol 12,13-Dioctanoate | CHEMBL507303|4alpha-Phorbol 12,13-dioctanoate|BDBM50277488

Canonical SMILES:  CCCCCCCC(=O)O[C@@H]1[C@@H](C)[C@@]2(O)[C@@H](C=C(CO)C[C@@]3(O)C(=O)C(C)=C[C@@H]23)[C@@H]2C(C)(C)[C@]12OC(=O)CCCCCCC

Standard InChI:  InChI=1S/C36H56O8/c1-7-9-11-13-15-17-28(38)43-32-24(4)35(42)26(20-25(22-37)21-34(41)27(35)19-23(3)31(34)40)30-33(5,6)36(30,32)44-29(39)18-16-14-12-10-8-2/h19-20,24,26-27,30,32,37,41-42H,7-18,21-22H2,1-6H3/t24-,26+,27-,30-,32-,34+,35-,36-/m1/s1

Standard InChI Key:  ICJPQGPENGQAOZ-FAXDXWKVSA-N

Molfile:  

     RDKit          2D

 47 50  0  0  0  0  0  0  0  0999 V2000
   12.3911  -17.8163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0031  -18.3545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8268  -18.4165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5544  -16.5885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2679  -17.0019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2688  -15.3556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5517  -15.7661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5397  -17.6703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7889  -16.8799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1142  -16.3987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4480  -16.8916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7110  -17.6774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8648  -16.1279    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9498  -17.4603    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.1255  -19.1855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9408  -19.3113    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1208  -18.3792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5000  -17.2917    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.6612  -16.6436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2320  -18.3491    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2709  -14.5306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8373  -15.3535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9823  -15.7690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9756  -16.5889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6890  -16.1847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5583  -17.1708    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.3875  -15.0500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5575  -14.1162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5596  -13.2912    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2125  -15.0415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6175  -14.3228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6323  -15.7516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2708  -16.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5125  -16.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8420  -14.5269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1286  -14.1126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4130  -14.5232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6996  -14.1089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9841  -14.5196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2707  -14.1052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5615  -14.5159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4425  -14.3142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8476  -13.5955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6725  -13.5870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0776  -12.8683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9026  -12.8597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3076  -12.1410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  7 22  1  6
 24 23  1  0
 25 24  1  0
 23 25  1  0
  5  1  1  0
  9  4  1  0
  9 10  1  0
 10 11  2  0
 24 26  1  6
 11 12  1  0
 23 27  1  6
 12  8  1  0
 21 28  1  0
  8  2  1  0
 28 29  2  0
  4 13  1  6
 27 30  1  0
 30 31  1  0
  5 14  1  1
 30 32  2  0
  4  7  1  0
 25 33  1  0
  3 15  1  0
 25 34  1  0
  5 24  1  0
 28 35  1  0
 15 16  1  0
 35 36  1  0
 23  6  1  0
 36 37  1  0
  8 17  1  6
 37 38  1  0
  6  7  1  0
 38 39  1  0
  9 18  1  6
 39 40  1  0
  8  9  1  0
 40 41  1  0
 11 19  1  0
 31 42  1  0
  1  3  2  0
 42 43  1  0
 12 20  2  0
 43 44  1  0
  2  3  1  0
 44 45  1  0
  6 21  1  1
 45 46  1  0
  4  5  1  0
 46 47  1  0
M  END

Alternative Forms

Associated Targets(non-human)

Trpv4 Transient receptor potential cation channel subfamily V member 4 (46 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 616.84Molecular Weight (Monoisotopic): 616.3975AlogP: 5.75#Rotatable Bonds: 15
Polar Surface Area: 130.36Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.57CX Basic pKa: CX LogP: 5.95CX LogD: 5.95
Aromatic Rings: Heavy Atoms: 44QED Weighted: 0.12Np Likeness Score: 2.31

References

1. Klausen TK, Pagani A, Minassi A, Ech-Chahad A, Prenen J, Owsianik G, Hoffmann EK, Pedersen SF, Appendino G, Nilius B..  (2009)  Modulation of the transient receptor potential vanilloid channel TRPV4 by 4alpha-phorbol esters: a structure-activity study.,  52  (9): [PMID:19361196] [10.1021/jm9001007]

Source