The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4,4'-(di-O-glycinoyl) curcumin ID: ALA507349
PubChem CID: 6481165
Max Phase: Preclinical
Molecular Formula: C25H26N2O8
Molecular Weight: 482.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OC(=O)CN)c(OC)c2)ccc1OC(=O)CN
Standard InChI: InChI=1S/C25H26N2O8/c1-32-22-11-16(5-9-20(22)34-24(30)14-26)3-7-18(28)13-19(29)8-4-17-6-10-21(23(12-17)33-2)35-25(31)15-27/h3-12H,13-15,26-27H2,1-2H3/b7-3+,8-4+
Standard InChI Key: PQKWQYCQFFFWCA-FCXRPNKRSA-N
Molfile:
RDKit 2D
35 36 0 0 0 0 0 0 0 0999 V2000
-2.2348 -14.4208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2359 -15.2482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5211 -15.6610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8047 -15.2477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8075 -14.4172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5229 -14.0080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0946 -14.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6214 -14.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3343 -13.9966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0503 -14.4064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3312 -13.1716 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7633 -13.9912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4793 -14.4010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7601 -13.1662 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1922 -13.9858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9082 -14.3956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9087 -15.2178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6238 -15.6275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3377 -15.2122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3320 -14.3830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6162 -13.9770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0434 -13.9653 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0543 -15.6211 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9493 -14.0085 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9495 -13.1835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9507 -15.6601 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0374 -13.1403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7667 -15.2050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4832 -15.6138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7624 -14.3800 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1956 -15.1977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6649 -15.2470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3797 -15.6590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6642 -14.4220 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.0938 -15.2459 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17 18 1 0
8 9 1 0
18 19 2 0
4 5 1 0
19 20 1 0
9 10 1 0
20 21 2 0
21 16 1 0
2 3 1 0
20 22 1 0
9 11 2 0
19 23 1 0
5 6 2 0
1 24 1 0
10 12 1 0
24 25 1 0
6 1 1 0
2 26 1 0
12 13 1 0
22 27 1 0
1 2 2 0
23 28 1 0
12 14 2 0
28 29 1 0
5 7 1 0
28 30 2 0
13 15 2 0
29 31 1 0
3 4 2 0
26 32 1 0
15 16 1 0
32 33 1 0
7 8 2 0
32 34 2 0
16 17 2 0
33 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 482.49Molecular Weight (Monoisotopic): 482.1689AlogP: 1.69#Rotatable Bonds: 12Polar Surface Area: 157.24Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.63CX Basic pKa: 7.23CX LogP: 2.10CX LogD: 1.84Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.20Np Likeness Score: 0.41
References 1. Dubey SK, Sharma AK, Narain U, Misra K, Pati U.. (2008) Design, synthesis and characterization of some bioactive conjugates of curcumin with glycine, glutamic acid, valine and demethylenated piperic acid and study of their antimicrobial and antiproliferative properties., 43 (9): [PMID:18201805 ] [10.1016/j.ejmech.2007.11.027 ]