4,4'-(di-O-glycinoyl) curcumin

ID: ALA507349

PubChem CID: 6481165

Max Phase: Preclinical

Molecular Formula: C25H26N2O8

Molecular Weight: 482.49

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OC(=O)CN)c(OC)c2)ccc1OC(=O)CN

Standard InChI:  InChI=1S/C25H26N2O8/c1-32-22-11-16(5-9-20(22)34-24(30)14-26)3-7-18(28)13-19(29)8-4-17-6-10-21(23(12-17)33-2)35-25(31)15-27/h3-12H,13-15,26-27H2,1-2H3/b7-3+,8-4+

Standard InChI Key:  PQKWQYCQFFFWCA-FCXRPNKRSA-N

Molfile:  

     RDKit          2D

 35 36  0  0  0  0  0  0  0  0999 V2000
   -2.2348  -14.4208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2359  -15.2482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5211  -15.6610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8047  -15.2477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8075  -14.4172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5229  -14.0080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0946  -14.0020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6214  -14.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3343  -13.9966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0503  -14.4064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3312  -13.1716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7633  -13.9912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4793  -14.4010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7601  -13.1662    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1922  -13.9858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9082  -14.3956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9087  -15.2178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6238  -15.6275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3377  -15.2122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3320  -14.3830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6162  -13.9770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0434  -13.9653    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0543  -15.6211    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9493  -14.0085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9495  -13.1835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9507  -15.6601    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0374  -13.1403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7667  -15.2050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4832  -15.6138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7624  -14.3800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1956  -15.1977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6649  -15.2470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3797  -15.6590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6642  -14.4220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0938  -15.2459    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
 17 18  1  0
  8  9  1  0
 18 19  2  0
  4  5  1  0
 19 20  1  0
  9 10  1  0
 20 21  2  0
 21 16  1  0
  2  3  1  0
 20 22  1  0
  9 11  2  0
 19 23  1  0
  5  6  2  0
  1 24  1  0
 10 12  1  0
 24 25  1  0
  6  1  1  0
  2 26  1  0
 12 13  1  0
 22 27  1  0
  1  2  2  0
 23 28  1  0
 12 14  2  0
 28 29  1  0
  5  7  1  0
 28 30  2  0
 13 15  2  0
 29 31  1  0
  3  4  2  0
 26 32  1  0
 15 16  1  0
 32 33  1  0
  7  8  2  0
 32 34  2  0
 16 17  2  0
 33 35  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA507349

   [4-[(1E,6E)-7-[4-(2-aminoacetyl)oxy-3-methoxyphenyl]-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] 2-aminoacetate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 482.49

Molecular Weight (Monoisotopic): 482.1689

AlogP: 1.69

#Rotatable Bonds: 12

Polar Surface Area: 157.24

Molecular Species: NEUTRAL

HBA: 10

HBD: 2

#RO5 Violations: ┄

HBA (Lipinski): 10

HBD (Lipinski): 4

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 9.63

CX Basic pKa: 7.23

CX LogP: 2.10

CX LogD: 1.84

Aromatic Rings: 2

Heavy Atoms: 35

QED Weighted: 0.20

Np Likeness Score: 0.41

References

1. Dubey SK, Sharma AK, Narain U, Misra K, Pati U..  (2008)  Design, synthesis and characterization of some bioactive conjugates of curcumin with glycine, glutamic acid, valine and demethylenated piperic acid and study of their antimicrobial and antiproliferative properties.,  43  (9): [PMID:18201805] [10.1016/j.ejmech.2007.11.027]

Source

Source(1):

• Scientific Literature