The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((1-(3,4-Dichlorobenzyl)-3,7-dimethyl-2,6-dioxo-2,3,6,7-tetrahydro-1H-purin-8-yl)amino)benzoic acid ID: ALA5075801
PubChem CID: 129269132
Max Phase: Preclinical
Molecular Formula: C21H17Cl2N5O4
Molecular Weight: 474.30
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cn1c(Nc2ccc(C(=O)O)cc2)nc2c1c(=O)n(Cc1ccc(Cl)c(Cl)c1)c(=O)n2C
Standard InChI: InChI=1S/C21H17Cl2N5O4/c1-26-16-17(25-20(26)24-13-6-4-12(5-7-13)19(30)31)27(2)21(32)28(18(16)29)10-11-3-8-14(22)15(23)9-11/h3-9H,10H2,1-2H3,(H,24,25)(H,30,31)
Standard InChI Key: FYAJFNIHHGJBTF-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
2.3477 -8.3342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3466 -9.1614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0610 -9.5740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7772 -9.1609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7744 -8.3306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0593 -7.9217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4921 -9.5721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2056 -9.1587 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9211 -9.5716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9208 -7.9232 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2031 -8.3347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9208 -10.3963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4889 -7.9225 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9223 -7.0986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6333 -7.9221 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.6320 -9.5731 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.6355 -8.3365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6307 -9.1643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4165 -9.4247 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9069 -8.7577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4242 -8.0854 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7316 -8.7625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1480 -8.0506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9741 -8.0588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3905 -7.3511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9856 -6.6322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1601 -6.6255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7393 -7.3378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6668 -10.2104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4048 -5.9219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2294 -5.9298 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9992 -5.2039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 1 0
8 11 1 0
9 18 1 0
17 10 1 0
10 11 1 0
9 12 2 0
11 13 2 0
10 14 1 0
1 15 1 0
2 16 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 2 0
21 17 1 0
20 22 1 0
23 22 1 0
23 24 2 0
23 28 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
19 29 1 0
26 30 1 0
30 31 2 0
30 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 474.30Molecular Weight (Monoisotopic): 473.0658AlogP: 3.23#Rotatable Bonds: 5Polar Surface Area: 111.15Molecular Species: ACIDHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.59CX Basic pKa: ┄CX LogP: 4.17CX LogD: 1.44Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.46Np Likeness Score: -1.47
References 1. Lee LC, Peng YH, Chang HH, Hsu T, Lu CT, Huang CH, Hsueh CC, Kung FC, Kuo CC, Jiaang WT, Wu SY.. (2021) Xanthine Derivatives Reveal an Allosteric Binding Site in Methylenetetrahydrofolate Dehydrogenase 2 (MTHFD2)., 64 (15.0): [PMID:34337952 ] [10.1021/acs.jmedchem.1c00663 ]