The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(benzo[d]oxazol-2-ylamino)-4-(2-chlorophenyl)-N-(4-(hydroxymethyl)phenyl)-6-methyl-1,4-dihydropyrimidine-5-carboxamide ID: ALA5076126
PubChem CID: 73336273
Max Phase: Preclinical
Molecular Formula: C26H22ClN5O3
Molecular Weight: 487.95
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC1=C(C(=O)Nc2ccc(CO)cc2)C(c2ccccc2Cl)N=C(Nc2nc3ccccc3o2)N1
Standard InChI: InChI=1S/C26H22ClN5O3/c1-15-22(24(34)29-17-12-10-16(14-33)11-13-17)23(18-6-2-3-7-19(18)27)31-25(28-15)32-26-30-20-8-4-5-9-21(20)35-26/h2-13,23,33H,14H2,1H3,(H,29,34)(H2,28,30,31,32)
Standard InChI Key: LFGBVHXCDRABFL-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
10.7302 -5.3016 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.7437 -4.7164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7437 -3.5415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7571 -2.9568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7666 -3.5410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7666 -4.7112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7596 -5.2952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7596 -6.4655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7731 -7.0506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7866 -6.4654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8000 -7.0506 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8135 -6.4656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8139 -5.2952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8249 -4.7129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8387 -5.2982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8408 -6.4627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8313 -7.0533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8522 -4.7131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8657 -5.2982 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7866 -5.2952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7731 -8.2208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7865 -8.8059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7596 -8.8059 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7460 -8.2208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7326 -8.8060 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7191 -8.2208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5969 -7.0576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4527 -6.8144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8650 -5.7973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6961 -5.7973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1164 -6.8136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7017 -7.8274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8678 -7.8274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6506 -8.6966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7460 -7.0506 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
7 6 1 0
2 7 2 0
8 7 1 0
8 9 1 0
9 10 1 0
10 11 1 0
12 11 1 0
13 12 2 0
14 13 1 0
15 14 2 0
16 15 1 0
17 16 2 0
12 17 1 0
15 18 1 0
18 19 1 0
10 20 2 0
21 9 2 0
21 22 1 0
23 21 1 0
24 23 1 0
24 25 1 0
25 26 1 0
27 26 2 0
28 27 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
33 32 1 0
33 28 2 0
34 33 1 0
34 26 1 0
35 24 2 0
35 8 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 487.95Molecular Weight (Monoisotopic): 487.1411AlogP: 5.00#Rotatable Bonds: 5Polar Surface Area: 111.78Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.60CX Basic pKa: 4.17CX LogP: 4.17CX LogD: 4.17Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.32Np Likeness Score: -0.95
References 1. (2021) Galactokinase inhibitors, 2. Liu L, Tang M, Pragani R, Whitby FG, Zhang YQ, Balakrishnan B, Fang Y, Karavadhi S, Tao D, LeClair CA, Hall MD, Marugan JJ, Boxer M, Shen M, Hill CP, Lai K, Patnaik S.. (2021) Structure-Based Optimization of Small Molecule Human Galactokinase Inhibitors., 64 (18.0): [PMID:34491744 ] [10.1021/acs.jmedchem.1c00945 ]