2-(benzo[d]oxazol-2-ylamino)-4-(2-chlorophenyl)-N-(4-(hydroxymethyl)phenyl)-6-methyl-1,4-dihydropyrimidine-5-carboxamide

ID: ALA5076126

PubChem CID: 73336273

Max Phase: Preclinical

Molecular Formula: C26H22ClN5O3

Molecular Weight: 487.95

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1=C(C(=O)Nc2ccc(CO)cc2)C(c2ccccc2Cl)N=C(Nc2nc3ccccc3o2)N1

Standard InChI:  InChI=1S/C26H22ClN5O3/c1-15-22(24(34)29-17-12-10-16(14-33)11-13-17)23(18-6-2-3-7-19(18)27)31-25(28-15)32-26-30-20-8-4-5-9-21(20)35-26/h2-13,23,33H,14H2,1H3,(H,29,34)(H2,28,30,31,32)

Standard InChI Key:  LFGBVHXCDRABFL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   10.7302   -5.3016    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   11.7437   -4.7164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7437   -3.5415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7571   -2.9568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7666   -3.5410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7666   -4.7112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7596   -5.2952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7596   -6.4655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7731   -7.0506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7866   -6.4654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8000   -7.0506    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8135   -6.4656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8139   -5.2952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8249   -4.7129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8387   -5.2982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8408   -6.4627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8313   -7.0533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8522   -4.7131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8657   -5.2982    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7866   -5.2952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7731   -8.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7865   -8.8059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7596   -8.8059    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.7460   -8.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7326   -8.8060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7191   -8.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5969   -7.0576    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4527   -6.8144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8650   -5.7973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6961   -5.7973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1164   -6.8136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7017   -7.8274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8678   -7.8274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6506   -8.6966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7460   -7.0506    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  7  6  1  0
  2  7  2  0
  8  7  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 12 17  1  0
 15 18  1  0
 18 19  1  0
 10 20  2  0
 21  9  2  0
 21 22  1  0
 23 21  1  0
 24 23  1  0
 24 25  1  0
 25 26  1  0
 27 26  2  0
 28 27  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 33 32  1  0
 33 28  2  0
 34 33  1  0
 34 26  1  0
 35 24  2  0
 35  8  1  0
M  END

Associated Targets(Human)

GALK1 Tbio Galactokinase (959 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 487.95Molecular Weight (Monoisotopic): 487.1411AlogP: 5.00#Rotatable Bonds: 5
Polar Surface Area: 111.78Molecular Species: NEUTRALHBA: 7HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 9.60CX Basic pKa: 4.17CX LogP: 4.17CX LogD: 4.17
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.32Np Likeness Score: -0.95

References

1.  (2021)  Galactokinase inhibitors, 
2. Liu L, Tang M, Pragani R, Whitby FG, Zhang YQ, Balakrishnan B, Fang Y, Karavadhi S, Tao D, LeClair CA, Hall MD, Marugan JJ, Boxer M, Shen M, Hill CP, Lai K, Patnaik S..  (2021)  Structure-Based Optimization of Small Molecule Human Galactokinase Inhibitors.,  64  (18.0): [PMID:34491744] [10.1021/acs.jmedchem.1c00945]