1-(3'-fluorobiphenyl-3-yl)-4-(4-(furan-2-carbonyl)piperazin-1-yl)pyrrolidin-2-one

ID: ALA5076234

PubChem CID: 166626127

Max Phase: Preclinical

Molecular Formula: C25H24FN3O3

Molecular Weight: 433.48

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(c1ccco1)N1CCN(C2CC(=O)N(c3cccc(-c4cccc(F)c4)c3)C2)CC1

Standard InChI:  InChI=1S/C25H24FN3O3/c26-20-6-1-4-18(14-20)19-5-2-7-21(15-19)29-17-22(16-24(29)30)27-9-11-28(12-10-27)25(31)23-8-3-13-32-23/h1-8,13-15,22H,9-12,16-17H2

Standard InChI Key:  IEXPCWFLZGFRIA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   35.6702  -10.9495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6691  -11.7690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3771  -12.1780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0868  -11.7686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0840  -10.9459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3753  -10.5406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7901  -10.5346    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.5375  -10.8617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0820  -10.2523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6707   -9.5461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8721   -9.7192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2625   -9.1749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.8951  -10.3347    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.2275  -11.0821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0368  -11.1660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5183  -10.5053    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.1845   -9.7584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3692   -9.6721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3310  -10.5907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6634  -11.3373    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.8113   -9.9296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.6244   -9.9256    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.8769   -9.1484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2158   -8.6681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5547   -9.1485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3788  -12.9930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6694  -13.4008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6688  -14.2173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3770  -14.6269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0871  -14.2140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0842  -13.3990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7962  -14.6203    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  7  1  0
 11 12  2  0
  9 13  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 16 19  1  0
 19 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 21  2  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
  3 26  1  0
 30 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5076234

    ---

Associated Targets(non-human)

Mgll Monoglyceride lipase (234 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 433.48Molecular Weight (Monoisotopic): 433.1802AlogP: 3.65#Rotatable Bonds: 4
Polar Surface Area: 57.00Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.71CX LogP: 2.87CX LogD: 2.86
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.63Np Likeness Score: -1.58

References

1. He Y, Schild M, Grether U, Benz J, Leibrock L, Heer D, Topp A, Collin L, Kuhn B, Wittwer M, Keller C, Gobbi LC, Schibli R, Mu L..  (2022)  Development of High Brain-Penetrant and Reversible Monoacylglycerol Lipase PET Tracers for Neuroimaging.,  65  (3.0): [PMID:35089028] [10.1021/acs.jmedchem.1c01706]

Source