The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(4-((1S,2S,4S)-4-Amino-2-carboxycyclopentyl)phenyl)-7-(4-(trifluoromethyl)phenyl)-2-naphthoic Acid ID: ALA5076678
PubChem CID: 164585390
Max Phase: Preclinical
Molecular Formula: C30H24F3NO4
Molecular Weight: 519.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: N[C@@H]1C[C@H](C(=O)O)[C@@H](c2ccc(-c3cc(C(=O)O)cc4cc(-c5ccc(C(F)(F)F)cc5)ccc34)cc2)C1
Standard InChI: InChI=1S/C30H24F3NO4/c31-30(32,33)22-8-5-16(6-9-22)19-7-10-24-20(11-19)12-21(28(35)36)13-25(24)17-1-3-18(4-2-17)26-14-23(34)15-27(26)29(37)38/h1-13,23,26-27H,14-15,34H2,(H,35,36)(H,37,38)/t23-,26+,27-/m0/s1
Standard InChI Key: JVFPXXORCCXQLQ-RNJDCESWSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
36.3091 -3.6391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3079 -4.4641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0171 -4.8779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0153 -3.2255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7291 -3.6355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7299 -4.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4437 -4.8718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1572 -4.4562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1525 -3.6286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4382 -3.2206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8629 -3.2110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5783 -3.6200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.8580 -2.3884 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.5940 -3.2261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5951 -2.4024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8870 -1.9934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1690 -2.4029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1718 -3.2297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8888 -3.6391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4595 -1.9947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4583 -1.1679 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.7431 -2.4051 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.7389 -1.5806 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
38.4445 -5.6912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7307 -6.1012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7320 -6.9231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4464 -7.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1608 -6.9166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1560 -6.0961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4524 -8.1562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7918 -8.6396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0474 -9.4172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8659 -9.4144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1161 -8.6351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3493 -10.0750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.0126 -8.3893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8396 -7.5893 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.4062 -8.9391 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
9 11 1 0
11 12 1 0
11 13 2 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
1 14 1 0
17 20 1 0
20 21 1 0
20 22 1 0
20 23 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
7 24 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 30 1 0
30 27 1 1
33 35 1 6
31 36 1 6
36 37 2 0
36 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.52Molecular Weight (Monoisotopic): 519.1657AlogP: 6.80#Rotatable Bonds: 5Polar Surface Area: 100.62Molecular Species: ZWITTERIONHBA: 3HBD: 3#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.77CX Basic pKa: 10.29CX LogP: 3.70CX LogD: 1.18Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.27Np Likeness Score: -0.09
References 1. Wen Z, Salmaso V, Jung YH, Phung NB, Gopinatth V, Shah Q, Patterson AT, Randle JCR, Chen Z, Salvemini D, Lieberman DI, Whitehead GS, Karcz TP, Cook DN, Jacobson KA.. (2022) Bridged Piperidine Analogues of a High Affinity Naphthalene-Based P2Y14 R Antagonist., 65 (4.0): [PMID:35113556 ] [10.1021/acs.jmedchem.1c01964 ]